CAS Number152312-71-5
SynonymsBenzoic acid, 2-hydroxy-4-methoxy-, potassium salt (1:1); Potassium 2-hydroxy-4-methoxybenzoate; Potassium 4-methoxysalicylate; Potassium methoxysalicylate; UNII-5G3H7U4Y7F
Molecular FormulaC8H7KO4
Molecular Weight206.237
AppearanceAlmost white crystal or powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 152312-71-5 |
| Catalog No. | 2A-1174551 |
| Chinese Name | 4-甲氧基水杨酸钾 |
| Synonyms | Benzoic acid, 2-hydroxy-4-methoxy-, potassium salt (1:1); Potassium 2-hydroxy-4-methoxybenzoate; Potassium 4-methoxysalicylate; Potassium methoxysalicylate; UNII-5G3H7U4Y7F |
| Molecular Formula | C8H7KO4 |
| Molecular Weight | 206.237 |
| Appearance | Almost white crystal or powder |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2918990090 |
| PubChem ID | 45112684 |
| SMILES | COc1ccc(C(=O)[O-])c(O)c1.[K+] |
| InChI | InChI=1S/C8H8O4.K/c1-12-5-2-3-6(8(10)11)7(9)4-5;/h2-4,9H,1H3,(H,10,11);/q;+1/p-1 |
| InChI Key | YRJKYHIIYRGTCC-UHFFFAOYSA-M |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| cellobial | 490-51-7 | 2A-1174546 |
| HEXA-O-ACETYL-CELLOBIAL | 67314-36-7 | 2A-1174547 |
| N/A | 5346-85-0 | 2A-1174548 |
| 2-Chloro-N-MethylethanaMine Hydrochloride | 4535-90-4 | 2A-1174549 |
| N/A | 207726-02-6 | 2A-1174550 |
| 4-(alpha-Methylbenzyl)resorcinol | 85-27-8 | 2A-1174552 |
| 1,1'-Isopropylidenebis(p-phenyleneoxy)bis(4-nitrobenzene) | 20653-11-6 | 2A-1174553 |
| 1-(4-nitrophenoxy)-4-[4-(4-nitrophenoxy)phenyl]benzene | 17095-00-0 | 2A-1174554 |
| N/A | 69712-45-7 | 2A-1174555 |
| 2-Phenylbutyric acid | 90-27-7 | 2A-1174556 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS