
CAS Number86-54-4
Synonymshidralazin; hipoftalin; aprezolin; ciba5968; EINECS 201-680-3; apresoline; apresolin; 1-hydrazino-phthalazine; apressin
Molecular FormulaC8H8N4
Molecular Weight196.64
Purity98.00%
Density1.2583 (rough estimate)
Boiling Point276.07°C (rough estimate)
Melting Point172ºC
Appearanceyellow needle
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86-54-4 |
| Catalog No. | 2A-9017482 |
| Chinese Name | 肼酞嗪 |
| Synonyms | hidralazin; hipoftalin; aprezolin; ciba5968; EINECS 201-680-3; apresoline; apresolin; 1-hydrazino-phthalazine; apressin |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 196.64 |
| Purity | 98.00 |
| Density | 1.2583 (rough estimate) |
| Boiling Point | 276.07°C (rough estimate) |
| Melting Point | 172ºC |
| Appearance | yellow needle |
| Application | Hydralazine is an orally active antihypertensive drug that directly reduces peripheral resistance by relaxing the smooth muscle cell layer of arteries. Hydralazine has antioxidant activity and inhibit |
| PubChem ID | 329815153 |
| MDL Number | MFCD00135998 |
| SMILES | Cl[H].N\N=C1/N=NC=C2C=CC=CC12 |
| InChI | 1S/C8H8N4.ClH/c9-11-8-7-4-2-1-3-6(7)5-10-12-8;/h1-5,7H,9H2;1H/b11-8-; |
| InChI Key | SECXUXOCDLQOBI-MKFZHGHUSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/17482_1_86_54_4.pdf |
| Transport Info | Product Name: Hydralazine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL ALPHA-CHLOROACRYLATE | 80-63-7 | 2A-9017470 |
| N-Nitrosodiphenylamine | 86-30-6 | 2A-9017474 |
| 6,9-Dichloro-2-methoxyacridine | 86-38-4 | 2A-9017475 |
| 1-Hydroxy-2-naphthoic acid | 86-48-6 | 2A-9017478 |
| 1-Cyanonaphthalene | 86-53-3 | 2A-9017481 |
| 1-Naphthoic acid | 86-55-5 | 2A-9017483 |
| 1-Nitronaphthalene | 86-57-7 | 2A-9017485 |
| ANILINE (15N) | 7022-92-6 | 2A-9017486 |
| 7-Amino-1,3-naphthalenedisulfonic acid | 86-65-7 | 2A-9017488 |
| Fluorene | 86-73-7 | 2A-9017490 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA