
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4433-88-9 |
| Catalog No. | 2A-1174439 |
| Chinese Name | 乙酰基苯乙酸 |
| Synonyms | 3-Oxo-2-phenylbutanoic acid |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.315 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 303.2±30.0 °C at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 30328466 |
| MDL Number | MFCD18430375 |
| SMILES | CC(=O)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C10H10O3/c1-7(11)9(10(12)13)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,13) |
| InChI Key | LDXZZEGPQASJSK-UHFFFAOYSA-N |
| MSDS | msds/174792_1_4433_88_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ATTAPULGITE | 1337-76-4 | 2A-1174432 |
| 2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate | 96478-09-0 | 2A-1174435 |
| OLEOYL CHLORIDE | 112-77-6 | 2A-1174436 |
| Fatty acids, coco, esters with cottonseed-oil fatty acids, polyglycerol and soya fatty acids | 67784-82-1 | 2A-1174437 |
| BMK Glycidic Acid (sodium salt) | 5449-12-7 | 2A-1174438 |
| 1,1-DIPHENYL-2-PROPYN-1-OL | 3923-52-2 | 2A-1174442 |
| 1,1-bis(4-METHOXYPHENYL)-2-PROPYN-1-OL | 101597-25-5 | 2A-1174443 |
| (-)-ISOPINOCAMPHEYLAMINE | 69460-11-3 | 2A-1174451 |
| 5-(3-FLUOROPHENYL)-1,3,4-THIADIAZOL-2-AMINE | 59565-52-5 | 2A-1174452 |
| methyl 3-(4-aminomethylphenyl)propanoate(HCl) | 103565-40-8 | 2A-1174455 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA