![5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid structure, CAS 376592-58-4](/structures/180000/174764_1_376592_58_4.png)
CAS Number376592-58-4
Synonyms5'-Chloro-2'-hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid; 5'-chloro-2'-hydroxy-3'-nitrobiphenyl-3-carboxylic acid; 5'-Chloro-2'-hydroxy-3'-nitro-3-biphenylcarboxylic acid
Molecular FormulaC13H8ClNO5
Molecular Weight293.659
Density1.5±0.1 g/cm3
Boiling Point467.4±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 376592-58-4 |
| Catalog No. | 2A-1174412 |
| Chinese Name | 5'-氯-3'-硝基-2'-羟基-[1,1'-联苯]-3-甲酸 |
| Synonyms | 5'-Chloro-2'-hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid; 5'-chloro-2'-hydroxy-3'-nitrobiphenyl-3-carboxylic acid; 5'-Chloro-2'-hydroxy-3'-nitro-3-biphenylcarboxylic acid |
| Molecular Formula | C13H8ClNO5 |
| Molecular Weight | 293.659 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 467.4±45.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918199090 |
| PubChem ID | 34806358 |
| SMILES | O=C(O)c1cccc(-c2cc(Cl)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C13H8ClNO5/c14-9-5-10(12(16)11(6-9)15(19)20)7-2-1-3-8(4-7)13(17)18/h1-6,16H,(H,17,18) |
| InChI Key | PGNTVCRTPYDGRN-UHFFFAOYSA-N |
| MSDS | msds/174764_1_376592_58_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| tribromomethylbenzene | 2489-03-4 | 2A-1174351 |
| dimethyl 5-amino-2,4,6-triiodo-1,3-benzenedicarboxylate | 154921-11-6 | 2A-1174352 |
| 4-Methyl-6-(trifluoromethyl)pyrimidin-2(1H)-one | 91606-60-9 | 2A-1174361 |
| (2-methoxy-4-methylpyrimidin-5-yl)boronic acid | 1421933-77-8 | 2A-1174363 |
| [2-(trifluoromethyl)pyrimidin-5-yl]methanamine | 608515-92-0 | 2A-1174377 |
| 4-Oxo-3-(phenylMethoxy)-4H-pyran-2,5-dicarboxylic acid 2,5-diMethyl ester | 1246616-66-9 | 2A-1174414 |
| 2-(3-chloro-5-(trifluoroMethyl)pyridin-2-yl)ethanaMine | 658066-44-5 | 2A-1174425 |
| [1R-(1alpha,4abeta,4balpha,10aalpha)]-1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(isopropyl)phenanthrene-1-carboxylic acid, copper saltChemicalBook | 10248-55-2 | 2A-1174434 |
| 7-Bromo-9,9-dimethyl-9h-fluorene-2-carboxaldehyde | 944940-90-3 | 2A-1174444 |
| 3-(1-phenyl-1H-benzo[d]iMidazol-2-yl)phenylboronic acid | 1214723-26-8 | 2A-1174445 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA