
CAS Number480-39-7
SynonymsGalangin flavanone; (2S)-5,7-Dihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; Pinocembrin; (2S)-pinocembrin; Dihydrochrysin; (2S)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one; 5,7-Dihydroxyflavanone; (2S)-5,7-dihydroxy-2-phenylchroman-4-one
Molecular FormulaC15H12O4
Molecular Weight256.25
Purity≥95.0 (HPLC)%
Density1.4±0.1 g/cm3
Boiling Point511.1±50.0 °C at 760 mmHg
Melting Point194-195 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 480-39-7 |
| Catalog No. | 2A-1174405 |
| Chinese Name | 松属素; 乔松素 |
| Synonyms | Galangin flavanone; (2S)-5,7-Dihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; Pinocembrin; (2S)-pinocembrin; Dihydrochrysin; (2S)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one; 5,7-Dihydroxyflavanone; (2S)-5,7-dihydroxy-2-phenylchroman-4-one |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25 |
| Purity | ≥95.0 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 511.1±50.0 °C at 760 mmHg |
| Melting Point | 194-195 °C (lit.) |
| Appearance | solid |
| Storage Condition | room temperature |
| Application | Pinocembrin ((+)-Pinocoembrin) is a flavonoid obtained from propolis. It is a competitive histidine decarboxylase inhibitor and an effective anti-allergic agent with antioxidant, antibacterial and ant |
| PubChem ID | 329820219 |
| MDL Number | MFCD06858345 |
| SMILES | OC1=C(C(C[C@@H](C2=CC=CC=C2)O3)=O)C3=CC(O)=C1 |
| InChI | 1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2/t13-/m0/s1 |
| InChI Key | URFCJEUYXNAHFI-ZDUSSCGKSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/174755_1_480_39_7.pdf |
| Transport Info | Product name: Qiao Songsu |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Butanediol | 123513-85-9 | 2A-1174381 |
| (5-bromopyrimidin-2-yl)methanamine hydrochloride | 1240594-62-0 | 2A-1174395 |
| 6-Chloropyrimidin-2(1H)-one | 80927-55-5 | 2A-1174402 |
| SPIRAMYCIN ADIPATE | 68880-55-7 | 2A-1174390 |
| ISOPROPYL STEARATE | 112-10-7 | 2A-1174404 |
| ammonium propionate | 17496-08-1 | 2A-1174407 |
| TILETAMINE HYDROCHLORIDE | 14176-50-2 | 2A-1174408 |
| PotassiuM Azeloycinate Diglycinate | 477773-67-4 | 2A-0174409 |
| FUMARATE | 142-42-7 | 2A-1174335 |
| 1-(6-Methylpyridin-3-yl)-2-[4-(methylthio)phenyl]ethanone | 221615-72-1 | 2A-1174415 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA