
CAS Number286442-89-5
Synonyms1-methyl-3-oxo-cyclobutanecarboxylic acid; 1-Methyl-3-oxo-cyclobutancarbonsaeure; 1-Methyl-cyclobutanon-(3)-carbonsaeure-(1); 3-carboxy-3-methylcyclobutanone
Molecular FormulaC6H8O3
Molecular Weight128.12600
Density1.305±0.06 g/cm3(Predicted)
Boiling Point272.3±33.0 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 286442-89-5 |
| Catalog No. | 2A-1174350 |
| Chinese Name | 3-羰基-1-甲基-环丁烷甲酸 |
| Synonyms | 1-methyl-3-oxo-cyclobutanecarboxylic acid; 1-Methyl-3-oxo-cyclobutancarbonsaeure; 1-Methyl-cyclobutanon-(3)-carbonsaeure-(1); 3-carboxy-3-methylcyclobutanone |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.12600 |
| Density | 1.305±0.06 g/cm3(Predicted) |
| Boiling Point | 272.3±33.0 °C |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 132661257 |
| SMILES | CC1(C(=O)O)CC(=O)C1 |
| InChI | InChI=1S/C6H8O3/c1-6(5(8)9)2-4(7)3-6/h2-3H2,1H3,(H,8,9) |
| InChI Key | GURNKGAMQJTVCQ-UHFFFAOYSA-N |
| MSDS | msds/174698_1_286442_89_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile | 1231892-37-7 | 2A-1174278 |
| (Z)-3-chloro-3-phenylacrylaldehyde | 33603-87-1 | 2A-1174312 |
| (1E,2Z)-3-chloro-3-phenylacrylaldehyde oxime | 72806-43-0 | 2A-1174313 |
| 6-methoxynicotinohydrazide | 89853-74-7 | 2A-1174316 |
| Methyl 3-oxo-1-Methyl-cyclobutanecarboxylate | 1408075-88-6 | 2A-1174349 |
| tribromomethylbenzene | 2489-03-4 | 2A-1174351 |
| dimethyl 5-amino-2,4,6-triiodo-1,3-benzenedicarboxylate | 154921-11-6 | 2A-1174352 |
| 4-Methyl-6-(trifluoromethyl)pyrimidin-2(1H)-one | 91606-60-9 | 2A-1174361 |
| (2-methoxy-4-methylpyrimidin-5-yl)boronic acid | 1421933-77-8 | 2A-1174363 |
| [2-(trifluoromethyl)pyrimidin-5-yl]methanamine | 608515-92-0 | 2A-1174377 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA