CAS Number101-87-1
SynonymsN-Phenyl-N'-cyclohexyl-p-phenylenediamine; N-cyclohexyl-N'-phenyl-1,4-phenylenediamine; N-Cyclohexyl-N'-phenyl-1,4-benzenediamine; N-Cyclohexyl-N'-phenylbenzene-1,4-diamine; N-Cyclohexyl-N'-phenyl-p-phenylendiamine; N-Cyclohexyl-N'-phenyl-p-phenylendiamin; p-Phenylenediamine,N-cyclohexyl-N'-phenyl; Flexzone 6H; p-Phenylenediamine,N-phenyl-N'-cyclohexyl; EINECS 202-984-9; Vulkacit 4010 [Czech]; N1-cyclohexyl-N4-phenylbenzene-1,4-diamine
Molecular FormulaC18H22N2
Molecular Weight266.381
Density1.1±0.1 g/cm3
Boiling Point440.2±28.0 °C at 760 mmHg
Melting Point>100ºC
Appearancepurple powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 101-87-1 |
| Catalog No. | 2A-1174283 |
| Chinese Name | N-环己基-N'-苯基对苯二胺 |
| Synonyms | N-Phenyl-N'-cyclohexyl-p-phenylenediamine; N-cyclohexyl-N'-phenyl-1,4-phenylenediamine; N-Cyclohexyl-N'-phenyl-1,4-benzenediamine; N-Cyclohexyl-N'-phenylbenzene-1,4-diamine; N-Cyclohexyl-N'-phenyl-p-phenylendiamine; N-Cyclohexyl-N'-phenyl-p-phenylendiamin; p-Phenylenediamine,N-cyclohexyl-N'-phenyl; Flexzone 6H; p-Phenylenediamine,N-phenyl-N'-cyclohexyl; EINECS 202-984-9; Vulkacit 4010 [Czech]; N1-cyclohexyl-N4-phenylbenzene-1,4-diamine |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.381 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 440.2±28.0 °C at 760 mmHg |
| Melting Point | >100ºC |
| Appearance | purple powder |
| Storage Condition | Store in a cool, dry and ventilated place. Pay att |
| HTC | 2921590090 |
| PubChem ID | 10225177 |
| SMILES | c1ccc(Nc2ccc(NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1,3-4,7-8,11-14,16,19-20H,2,5-6,9-10H2 |
| InChI Key | ZRMMVODKVLXCBB-UHFFFAOYSA-N |
| MSDS | msds/174625_1_101_87_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Difluoro-3-(propylsulfonaMido)benzoic acid | 1103234-56-5 | 2A-1174269 |
| 3-isopropylphenol | 618-45-1 | 2A-1174272 |
| 1-naphthalen-2-ylbutane-1,3-dione | 13298-50-5 | 2A-1174273 |
| 1-cyclobutylpyrazol-4-amine | 1190380-64-3 | 2A-1174276 |
| N-acetyl-2-phenylacetamide | 10543-56-3 | 2A-1174279 |
| 2-(Hydroxymethyl)isonicotinic acid | 915140-06-6 | 2A-1174284 |
| Quaternary ammonium compounds, coco alkyltrimethyl, chlorides | 61789-18-2 | 2A-1174288 |
| Octyl 4-methoxycinnamate | 5466-77-3 | 2A-1174294 |
| NICKEL NAPHTHENATE | 61788-71-4 | 2A-1174296 |
| Ethyl 3-(2,6-Difluorophenyl)-3-oxopropionate | 97305-12-9 | 2A-1174295 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS