
CAS Number35718-08-2
Synonymspropargyloxycarbonyl chloride; 2-propynyl chloroformate; MFCD00270127; Carbonochloridic acid, 2-propyn-1-yl ester; chlorocarbonic acid prop-2-ynyl ester; prop-2-yn-1-yl carbonochloridate; 2-Propyn-1-yl carbonochloridate; prop-2-ynyl chloroformate; propargylchloroformate; 2-Propynyl chloroformate
Molecular FormulaC4H3ClO2
Molecular Weight118.518
Purity98.00%
Density1.271±0.06 g/cm
Boiling Point118-122 ºC
Appearancecolorless oily liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35718-08-2 |
| Catalog No. | 2A-1174173 |
| Chinese Name | 2-丙炔基氯甲酸酯 |
| Synonyms | propargyloxycarbonyl chloride; 2-propynyl chloroformate; MFCD00270127; Carbonochloridic acid, 2-propyn-1-yl ester; chlorocarbonic acid prop-2-ynyl ester; prop-2-yn-1-yl carbonochloridate; 2-Propyn-1-yl carbonochloridate; prop-2-ynyl chloroformate; propargylchloroformate; 2-Propynyl chloroformate |
| Molecular Formula | C4H3ClO2 |
| Molecular Weight | 118.518 |
| Purity | 98.00 |
| Density | 1.271±0.06 g/cm |
| Boiling Point | 118-122 ºC |
| Appearance | colorless oily liquid |
| Water Solubility | Sparingly soluble (26 g/L) (25 ºC) |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2915900090 |
| PubChem ID | 4458879 |
| SMILES | C#CCOC(=O)Cl |
| InChI | InChI=1S/C4H3ClO2/c1-2-3-7-4(5)6/h1H,3H2 |
| InChI Key | RAMTXCRMKBFPRG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(1H-Indol-2-yl)butyric acid | 29873-09-4 | 2A-1174223 |
| 2,2′-(1,4-phenylene)diacetamide | 30038-76-7 | 2A-1174224 |
| 2-hydroxyethyl acetoacetate | 33736-01-5 | 2A-1174226 |
| 4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE | 3415-35-8 | 2A-1174227 |
| SULFAGUANIDINE | 56-67-0 | 2A-1174229 |
| Ethanone, 2-chloro-1-(1-chlorocyclopropyl)- (9CI) | 120983-72-4 | 2A-1174231 |
| cyanopindolol | 81608-27-7 | 2A-1174232 |
| GeA-69 | 2143475-98-1 | 2A-1174233 |
| A 381393 | 726174-00-1 | 2A-1174234 |
| (1-Phenyl-ethyl)-(2-piperazin-1-yl-quinazolin-4-yl)-amine | 662164-09-2 | 2A-1174235 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA