
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1226762-74-8 |
| Catalog No. | 2A-1174200 |
| Chinese Name | 7-溴喹啉-3-羧酸乙酯 |
| Synonyms | 7-bromoquinoline-3-carboxylic acid ethyl ester |
| Molecular Formula | C12H10BrNO2 |
| Molecular Weight | 280.11700 |
| Density | 1.495±0.06 g/cm3(Predicted) |
| Boiling Point | 360.9±22.0 °C(Predicted) |
| Melting Point | 98.2-99.1 °C |
| Appearance | White to yellow solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2933499090 |
| PubChem ID | 96077440 |
| SMILES | CCOC(=O)c1cnc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C12H10BrNO2/c1-2-16-12(15)9-5-8-3-4-10(13)6-11(8)14-7-9/h3-7H,2H2,1H3 |
| InChI Key | NCEAPXMAJIWHHN-UHFFFAOYSA-N |
| MSDS | msds/174540_1_1226762_74_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Bromo-7,8-difluoro-2-methylquinoline | 1189106-60-2 | 2A-1174195 |
| ethyl 7-bromoquinoline-2-carboxylate | 1196153-95-3 | 2A-1174196 |
| 6-fluoroquinoline-3-carbaldehyde | 1196154-66-1 | 2A-1174197 |
| 6-bromoquinoline-3-carbaldehyde | 1196155-68-6 | 2A-1174198 |
| 2-Phenyl-7-BroMoquinoline | 1203578-65-7 | 2A-1174199 |
| 4-Bromo-8-methoxyquinoline-3-carboxylic acid ethyl ester | 1242260-60-1 | 2A-1174201 |
| ethyl 6-fluoroquinoline-2-carboxylate | 1356126-69-6 | 2A-1174206 |
| ethyl 5-bromoquinoline-3-carboxylate | 1383551-36-7 | 2A-1174207 |
| 5-bromoquinoline-3-carboxylic acid | 1416438-47-5 | 2A-1174208 |
| 3-Ethylindole | 1484-19-1 | 2A-1174210 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA