
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 88755-16-2 |
| Catalog No. | 2A-1174179 |
| Chinese Name | 2-酮-2-(3,4,5-三甲氧苯基)乙酸 |
| Synonyms | Benzeneacetic acid,3,4,5-trimethoxy-a-oxo; 3,4,5-Trimethoxybenzoylformic acid |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 16204425 |
| MDL Number | MFCD03844682 |
| SMILES | COc1cc(C(=O)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C11H12O6/c1-15-7-4-6(9(12)11(13)14)5-8(16-2)10(7)17-3/h4-5H,1-3H3,(H,13,14) |
| InChI Key | LADJHQSUVNTXES-UHFFFAOYSA-N |
| MSDS | msds/174519_1_88755_16_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Clocortolone Pivalate | 34097-16-0 | 2A-1174173 |
| Clocortolone Caproate | 4891-71-8 | 2A-1174174 |
| 11α,17α-dihydroxy-pegn-4-ene-3,20-dione | 2A-1174175 | 2A-1174175 |
| 11α,17α-dihydroxy-pegn-1,4-diene-3,20-dione | 2A-1174176 | 2A-1174176 |
| ALEURITIC ACID | 533-87-9 | 2A-1174178 |
| 3,5-Diphenyl-2-isoxazoline | 4894-23-9 | 2A-1174180 |
| 3-BROMO-4-METHYL-5-NITROBENZOIC ACID | 34545-20-5 | 2A-1174183 |
| m-Meconin | 531-88-4 | 2A-1174185 |
| 3-BROMO-2-NITRO-BENZOIC ACID | 116529-61-4 | 2A-1174194 |
| Hexadecanoic acid, 2-hexyldodecyl ester | 134112-34-8 | 2A-1174205 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA