
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 882772-99-8 |
| Catalog No. | 2A-1174120 |
| Chinese Name | 3-溴-2-硝基苯甲醛 |
| Synonyms | MFCD00462872 |
| Molecular Formula | C9H8BrNO5 |
| Molecular Weight | 290.072 |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2913000090 |
| PubChem ID | 49711649 |
| MDL Number | MFCD00034518 |
| SMILES | O=Cc1cccc(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4BrNO3/c8-6-3-1-2-5(4-10)7(6)9(11)12/h1-4H |
| InChI Key | DAZQBQQNIUAQAV-UHFFFAOYSA-N |
| MSDS | msds/174459_1_882772_99_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Phenyl (trifluoromethyl) sulfone | 426-58-4 | 2A-1174035 |
| TriMethyl(broModifluoroMethyl)silane | 115262-01-6 | 2A-1174037 |
| Methyl 1-oxo-2,3-dihydro-1H-indene-5-carboxylate | 68634-02-6 | 2A-1174069 |
| 6-(TrifluoroMethyl)picoliniMidaMide hydrochloride | 264884-49-3 | 2A-1174073 |
| Methyl2-(2-amino-4-(trifluoromethyl)phenyl)acetate | 13544-08-6 | 2A-1174079 |
| 6-(4-methylphenyl)sulfonyl-2-oxa-6-azaspiro[3.3]heptane | 13573-28-9 | 2A-1174177 |
| 6-(TRIFLUOROMETHYL)-4,5-DIHYDROPYRIDAZIN-3(2H)-ONE | 628332-15-0 | 2A-1174184 |
| 2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide | 163451-81-8 | 2A-1174190 |
| 1-Bromo-3-chloromethyl-2-nitro-benzene | 1261583-24-7 | 2A-1174203 |
| 2-cyano-N-[4-(trifluoromethyl)phenyl]acetamide | 24522-30-3 | 2A-1174217 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA