
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1035235-10-9 |
| Catalog No. | 2A-1174081 |
| Chinese Name | 4-(2-溴苯基)-2,4-二氧代丁酸甲酯 |
| Synonyms | Benzenebutanoic acid, 2-bromo-α,γ-dioxo-, methyl ester; Methyl 4-(2-bromophenyl)-2,4-dioxobutanoate |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.091 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 390.5±27.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918300090 |
| PubChem ID | 86676549 |
| SMILES | COC(=O)C(=O)CC(=O)c1ccccc1Br |
| InChI | InChI=1S/C11H9BrO4/c1-16-11(15)10(14)6-9(13)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3 |
| InChI Key | VKMVKAZSQQFHRS-UHFFFAOYSA-N |
| MSDS | msds/174419_1_1035235_10_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 5-Pyrimidinecarbonitrile, 2,4-diamino-6-chloro- | 900456-21-5 | 2A-1173947 |
| 6-bromo-2,4-dichloropyrido[2,3-d]pyrimidine | 1234616-70-6 | 2A-1173960 |
| 3-(2-(4-chlorophenoxy)phenyl)-1-methylpyrrolidine-2,4-dione | 1352744-53-6 | 2A-4173962 |
| 5-AMINO-2,4-DIHYDROXY-6-METHYLPYRIMIDINE | 6270-46-8 | 2A-1174062 |
| 2,4-dichloro-6-hydroxyquinazoline | 464927-05-7 | 2A-1174077 |
| ethyl 3-oxo-4-(2,4,5-trifluorophenyl)butanoate | 1151240-88-8 | 2A-1174192 |
| N-(3-Amino-2,4-difluorophenyl)propanesulfonamide | 1103234-57-6 | 2A-1174274 |
| 6-amino-3-methyl-1-(ethyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione | 41862-13-9 | 2A-1174281 |
| 5,5-dimethyl-1,3-bis(oxiranylmethyl)imidazolidine-2,4-dione | 28906-98-1 | 2A-1174428 |
| 2,4-DIMETHYL, 1,3-DIOXALONE | 3390-12-3 | 2A-1174459 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA