
CAS Number13252-13-6
Synonyms(+)-2-(heptafluoropropoxy)perfluoropropionic acid; 2-(HEPTAFLUOROPROPOXY)-2,3,3,3-TETRAFLUOROPROPIONIC ACID; 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propionic acid; MFCD00236734; UNDECAFLUORO-2-METHYL-3-OXAHEXANOIC ACID; 2-(Heptafluoropropoxy)tetrafluoropropionic acid; (heptafluoropropoxy)perfluoropropionic acid; perfluoro-2-methyl-3-oxahexanol fluoride; perfluoro(2-methyl-3-oxa)hexanoic acid; EINECS 236-236-8; rac-perfluoro-2-n-propoxypropionic acid; 2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropanoic acid; METHYL UNDECAFLUORO-2-METHYL-3-OXAHEXANOATE; HFPO DIMER ACID
Molecular FormulaC6HF11O3
Molecular Weight330.05
Density1.748g/cm3
Boiling Point187.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13252-13-6 |
| Catalog No. | 2A-1173937 |
| Chinese Name | 全氟(2-甲基-3-氧杂己酸) |
| Synonyms | (+)-2-(heptafluoropropoxy)perfluoropropionic acid; 2-(HEPTAFLUOROPROPOXY)-2,3,3,3-TETRAFLUOROPROPIONIC ACID; 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propionic acid; MFCD00236734; UNDECAFLUORO-2-METHYL-3-OXAHEXANOIC ACID; 2-(Heptafluoropropoxy)tetrafluoropropionic acid; (heptafluoropropoxy)perfluoropropionic acid; perfluoro-2-methyl-3-oxahexanol fluoride; perfluoro(2-methyl-3-oxa)hexanoic acid; EINECS 236-236-8; rac-perfluoro-2-n-propoxypropionic acid; 2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropanoic acid; METHYL UNDECAFLUORO-2-METHYL-3-OXAHEXANOATE; HFPO DIMER ACID |
| Molecular Formula | C6HF11O3 |
| Molecular Weight | 330.05 |
| Density | 1.748g/cm3 |
| Boiling Point | 187.5ºC at 760mmHg |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| Packaging | II |
| HTC | 2918990090 |
| PubChem ID | 797315 |
| MDL Number | MFCD00236734 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(=O)O |
| InChI | 1S/C6HF11O3/c7-2(1(18)19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15/h(H,18,19) |
| InChI Key | CSEBNABAWMZWIF-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 12352106 |
| MSDS | msds/174270_1_13252_13_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Perfluoroisobutyronitrile | 42532-60-5 | 2A-1173932 |
| 1H,2H-HEXAFLUOROCYCLOPENTENE | 1005-73-8 | 2A-1173933 |
| 1H-HEPTAFLUOROCYCLOPENTENE | 1892-03-1 | 2A-1173934 |
| 1,1,2,2,3,3,4-HEPTAFLUOROCYCLOPENTANE | 15290-77-4 | 2A-1173935 |
| 1,2-DICHLOROTETRAFLUOROETHANE | 76-14-2 | 2A-1173936 |
| 1H,1H,2H,2H-PERFLUORODECANETHIOL | 34143-74-3 | 2A-1173938 |
| DIPYRIMIDIN-2-YL DISULPHIDE | 15718-46-4 | 2A-1173940 |
| 2-methoxy-4-methyl-pyrimidin-5-ylamine | 908099-97-8 | 2A-1173949 |
| 5-CHLORO-6-ETHYLPYRIMIDIN-4-AMINE | 130129-59-8 | 2A-1173950 |
| 3-amino-3-methylbutanamide | 173337-04-7 | 2A-1173953 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA