CAS Number163702-07-6
SynonymsPerfluorobutyl Methyl Ether; METHYL NONAFLUOROBUTYL ETHER; Methyl Perfluorobutyl Ether; MFCD00674093; Nonafluorobutyl Methyl Ether; 1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane
Molecular FormulaCH3OCF2R, R = -CF2CF2CF3 or -CF(CF3)2
Molecular Weight250.06
Purity≥99.0 (total assay of isomers, GC)%
Density1.529 g/mL at 20 °C
Boiling Point60 °C (lit.)
Melting Point−135 °C (lit.)
Appearanceliquid
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 163702-07-6 |
| Catalog No. | 2A-1173929 |
| Chinese Name | 甲基九氟丁醚 |
| Synonyms | Perfluorobutyl Methyl Ether; METHYL NONAFLUOROBUTYL ETHER; Methyl Perfluorobutyl Ether; MFCD00674093; Nonafluorobutyl Methyl Ether; 1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane |
| Molecular Formula | CH3OCF2R, R = -CF2CF2CF3 or -CF(CF3)2 |
| Molecular Weight | 250.06 |
| Purity | ≥99.0 (total assay of isomers, GC) |
| Density | 1.529 g/mL at 20 °C |
| Boiling Point | 60 °C (lit.) |
| Melting Point | −135 °C (lit.) |
| Appearance | liquid |
| Storage Condition | room temperature |
| PubChem ID | 24883826 |
| MDL Number | MFCD28505595 |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.COC(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/2C5H3F9O/c1-15-5(13,14)3(8,9)2(6,7)4(10,11)12;1-15-5(13,14)2(6,3(7,8)9)4(10,11)12/h2*1H3 |
| InChI Key | OKIYQFLILPKULA-UHFFFAOYSA-N |
| Beilstein/REAXYS | 8768491 |
| NACRES Code | NA.21 |
| UNSPSC | 12352101 |
| MSDS | msds/174262_1_163702_07_6.pdf |
| Transport Info | Product name: Methyl nonafluorobutyl ether |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2,3,3,3-PENTAFLUOROPROPYL ACRYLATE | 356-86-5 | 2A-1173924 |
| 2,2,3,3-TETRAFLUOROPROPYL ACRYLATE | 7383-71-3 | 2A-1173925 |
| Methyl 2,2-difluoropropanoate | 38650-84-9 | 2A-1173926 |
| 1-FLUOROPYRIDINIUM TRIFLATE | 107263-95-6 | 2A-1173927 |
| Actyflon-G05 | 20109-57-3 | 2A-1173928 |
| trans-1-Chloro-3,3,3-trifluoroprop-1-ene | 102687-65-0 | 2A-1173930 |
| Perfluoroisobutyronitrile | 42532-60-5 | 2A-1173932 |
| 1H,2H-HEXAFLUOROCYCLOPENTENE | 1005-73-8 | 2A-1173933 |
| 1H-HEPTAFLUOROCYCLOPENTENE | 1892-03-1 | 2A-1173934 |
| 1,1,2,2,3,3,4-HEPTAFLUOROCYCLOPENTANE | 15290-77-4 | 2A-1173935 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS