
CAS Number930836-30-9
Synonyms{[Chloro(difluoro)methyl]sulfonyl}benzene; chlorodifluoromethylphenyl sulfone; chlorodifluoromethyl phenyl sulfone; ((Chlorodifluoromethyl)sulfonyl)benzene; 1-(Chlorodifluoromethylsulfonyl)benzene
Molecular FormulaC7H5O2Cl1S1F2
Molecular Weight226.63
Density1.5±0.1 g/cm3
Boiling Point276.6±40.0 °C at 760 mmHg
AppearanceWhite to light yellow crystal or low melting point solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 930836-30-9 |
| Catalog No. | 2A-1173912 |
| Chinese Name | 氯二氟甲基苯基砜 |
| Synonyms | {[Chloro(difluoro)methyl]sulfonyl}benzene; chlorodifluoromethylphenyl sulfone; chlorodifluoromethyl phenyl sulfone; ((Chlorodifluoromethyl)sulfonyl)benzene; 1-(Chlorodifluoromethylsulfonyl)benzene |
| Molecular Formula | C7H5O2Cl1S1F2 |
| Molecular Weight | 226.63 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 276.6±40.0 °C at 760 mmHg |
| Appearance | White to light yellow crystal or low melting point solid |
| Storage Condition | 2-8°C, sealed, dry |
| PubChem ID | 49652439 |
| MDL Number | MFCD18253567 |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C7H5ClF2O2S/c8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-5H |
| InChI Key | DZKIZVXCLNLUJF-UHFFFAOYSA-N |
| MSDS | msds/174245_1_930836_30_9.pdf |
| Transport Info | Product name: Chlorodifluoromethylphenyl sulfone |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| methyl 2-(bromomethyl)-5-chloro-4-nitrobenzoate | 1441173-02-9 | 2A-1173883 |
| methyl 5-bromo-2-(bromomethyl)-4-nitrobenzoate | 2A-1173884 | 2A-1173884 |
| methyl 2-(dibromomethyl)-5-fluoro-4-nitrobenzoate | 2102178-13-0 | 2A-1173885 |
| methyl 5-chloro-2-(dibromomethyl)-4-nitrobenzoate | 143034-84-8 | 2A-1173886 |
| (chlorodifluoroMethyl)triMethylsilane | 115262-00-5 | 2A-1173911 |
| BroModifluoroMethyl phenyl sulfone | 80351-58-2 | 2A-1173913 |
| 1-Fluoro-cyclopropanecarboxylic acid | 137081-41-5 | 2A-1173931 |
| 1,3-Benzenedicarboxylic acid, 5-(hydroxyMethyl)-, 1,3-diMethyl ester | 109862-53-5 | 2A-1173964 |
| dimethyl 2'-amino-1,1':4,1''-terphenyl-4,4''-dicarboxylate | 1312703-30-2 | 2A-1173968 |
| 4-Bromo-1-dibromomethyl-2-fluoro-benzene | 295803-26-8 | 2A-1173978 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA