CAS Number1204298-65-6
Synonyms5-difluoromethyl-1-methyl-1H-pyrazole-4-carboxylic acid; 1-methyl-5-difluoromethyl-pyrazol-4-carboxylic acid; 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid; 5-difluoro-methyl-1-methylpyrazole-4-carboxylic acid
Molecular FormulaC6H6O2N2F2
Molecular Weight176.12
Density1.5±0.1 g/cm3
Boiling Point315.9±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1204298-65-6 |
| Catalog No. | 2A-1173835 |
| Chinese Name | 5-(二氟甲基)-1-甲基-1H-吡唑-4-羧酸 |
| Synonyms | 5-difluoromethyl-1-methyl-1H-pyrazole-4-carboxylic acid; 1-methyl-5-difluoromethyl-pyrazol-4-carboxylic acid; 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid; 5-difluoro-methyl-1-methylpyrazole-4-carboxylic acid |
| Molecular Formula | C6H6O2N2F2 |
| Molecular Weight | 176.12 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 315.9±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 117479611 |
| MDL Number | MFCD12827721 |
| SMILES | Cn1ncc(C(=O)O)c1C(F)F |
| InChI | InChI=1S/C6H6F2N2O2/c1-10-4(5(7)8)3(2-9-10)6(11)12/h2,5H,1H3,(H,11,12) |
| InChI Key | CTTXMUZEFPPHGD-UHFFFAOYSA-N |
| MSDS | msds/174148_1_1204298_65_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ethyl 3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate | 141573-95-7 | 2A-1173828 |
| 4-Amino-5-chloro-2,3-dihydro-7-benzofurancarboxylic acid | 123654-26-2 | 2A-1173831 |
| 2-Pyridinesulfonamide,6-fluoro-(9CI) | 124433-70-1 | 2A-1173832 |
| Ethyl 1-methyl-5-(difluoromethyl)-1H-pyrazole-4-carboxylate | 851725-98-9 | 2A-1173833 |
| 4-Formyl-3-(trifluoromethyl)-1-methyl-1H-pyrazole | 1094484-55-5 | 2A-1173834 |
| 5-(difluoromethyl)-1-methyl-1h-pyrazole-4-carbaldehyde | 1204298-70-3 | 2A-1173836 |
| 6-(5-((2-(Methylsulfonyl)ethylaMino)Methyl)furan-2-yl)quinazolin-4(3h)-one | 1334953-74-0 | 2A-1173841 |
| N2,N2-diethyl-6-methylpyridine-2,5-diamine dihydrochloride | 168091-36-9 | 2A-1173843 |
| 2,6-Diamino-4-bromopyridine-N-oxide | 491843-52-8 | 2A-1173846 |
| 3-(2'-AMINOACETYL)PYRIDINE DIHYDROCHLORIDE | 51746-82-8 | 2A-1173847 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS