
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79491-45-5 |
| Catalog No. | 2A-1173813 |
| Chinese Name | 2,6-二溴-3-甲氧基吡啶 |
| Synonyms | T6NJ BE CO1 FE; QC-9874; 2,6-Dibromo-3-methoxypyridine; Pyridine,2,6-dibromo-3-methoxy |
| Molecular Formula | C6H5O1N1Br2 |
| Molecular Weight | 266.92 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 294.5±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2933399090 |
| PubChem ID | 16425201 |
| MDL Number | MFCD26743441 |
| SMILES | COc1ccc(Br)nc1Br |
| InChI | InChI=1S/C6H5Br2NO/c1-10-4-2-3-5(7)9-6(4)8/h2-3H,1H3 |
| InChI Key | JFWDQTIVECPBDE-UHFFFAOYSA-N |
| MSDS | msds/174123_1_79491_45_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-[4-(Trifluoromethyl)phenyl]-1H-tetrazole | 2251-79-8 | 2A-1173793 |
| 5-(4-Fluorophenyl)-2H-tetrazole | 50907-21-6 | 2A-1173795 |
| 5-(2-METHYLPHENYL)-1H-TETRAZOLE | 51449-86-6 | 2A-1173796 |
| Pyridine, 3-hydrazino-2-methoxy- (9CI) | 160590-38-5 | 2A-1173797 |
| Ethyl 2-aMino-4-isopropylthiophene-3-carboxylate | 72965-16-3 | 2A-1173797 |
| 5-(Piperazin-1-yl)pyridine-2-carboxamide | 2044836-36-2 | 2A-1173815 |
| 1-(4-CHLOROPHENYL)-3-HYDROXY-1H-PYRAZOLE | 76205-19-1 | 2A-1173818 |
| 2,5-diMethoxy-4(3H)-PyriMidinone | 370103-23-4 | 2A-1173820 |
| 4-Formyl-5-(trifluoromethyl)-1-methyl-1H-pyrazole | 497833-04-2 | 2A-1173823 |
| 3-(Difluoromethyl)-5-hydroxy-1-methyl-1H-pyrazole-4-carbaldehyde | 1203145-73-6 | 2A-1173826 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA