
CAS Number53056-20-5
Synonyms(2,4-Dichlorophenyl)acetyl chloride; GV1R DG; 2,4-Dichlorobenzeneacetyl chloride; Dichlorophenylacetyl Chloride; 2-(2,4-dichlorophenyl)acetyl chloride; 2,4-Dichlorophenylacetyl chloride; 2,4-dichloro-phenyl chloride; 2-(2,4-dichlorophenoxy)ethanoyl chloride
Molecular FormulaC15H11Cl2NO2
Molecular Weight308.166
Density1.4±0.1 g/cm3
Boiling Point286.8±30.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53056-20-5 |
| Catalog No. | 2A-1173696 |
| Chinese Name | 2,4-二氯苯乙酰氯 |
| Synonyms | (2,4-Dichlorophenyl)acetyl chloride; GV1R DG; 2,4-Dichlorobenzeneacetyl chloride; Dichlorophenylacetyl Chloride; 2-(2,4-dichlorophenyl)acetyl chloride; 2,4-Dichlorophenylacetyl chloride; 2,4-dichloro-phenyl chloride; 2-(2,4-dichlorophenoxy)ethanoyl chloride |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.166 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 286.8±30.0 °C at 760 mmHg |
| HTC | 2918990090 |
| PubChem ID | 3185078 |
| MDL Number | MFCD02670208 |
| SMILES | O=C(Cl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl3O/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2 |
| InChI Key | RYXAJKPGHHNCSO-UHFFFAOYSA-N |
| MSDS | msds/174001_1_53056_20_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1,3,5-Triazine, 2,4-diphenyl-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] | 1696425-27-0 | 2A-1172873 |
| 1,3,5-Triazine, 2,4-diphenyl-6-(9,9'-spirobi[9H-fluoren]-2-yl)- | 1207176-84-8 | 2A-1172874 |
| 2,4-dihydroxyfuro[3,4-d]pyriMidin-7(5H)-one | 15783-48-9 | 2A-1173014 |
| 6-(hydroxymethyl)-3-[(4-methoxyphenyl)methylideneamino]oxane-2,4,5-tri ol | 51471-40-0 | 2A-1173173 |
| Trinexapac-ethyl | 95266-40-3 | 2A-1173548 |
| Methyl 2,4-diaMino-3-fluoro-5- nitrobenzoate | 918321-18-3 | 2A-1173731 |
| 2,4-dichloro-1-ethynylbenzene | 75717-77-0 | 2A-1173798 |
| BIFENAZATE | 149877-41-8 | 2A-1173805 |
| 5-Pyrimidinecarbonitrile, 2,4-diamino-6-chloro- | 900456-21-5 | 2A-1173947 |
| 6-bromo-2,4-dichloropyrido[2,3-d]pyrimidine | 1234616-70-6 | 2A-1173960 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA