
CAS Number93778-31-5
SynonymsPotassium 4-methyl-2-oxopentanoate; Pentanoic acid, 4-methyl-2-oxo-, potassium salt (1:1); PotassiuM 4-Methyl-2
Molecular Formula(CH3)2CHCH2COCOONa
Molecular Weight152.12
Purity>98 (TLC)%
Melting Point275 °C (dec.) (lit.)
Appearancepowder
EINECS224-816-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93778-31-5 |
| Catalog No. | 2A-1173554 |
| Chinese Name | 4-甲基-2-氧代戊酸钾 |
| Synonyms | Potassium 4-methyl-2-oxopentanoate; Pentanoic acid, 4-methyl-2-oxo-, potassium salt (1:1); PotassiuM 4-Methyl-2 |
| Molecular Formula | (CH3)2CHCH2COCOONa |
| Molecular Weight | 152.12 |
| Purity | >98 (TLC) |
| Melting Point | 275 °C (dec.) (lit.) |
| Appearance | powder |
| EINECS | 224-816-3 |
| HTC | 2918300090 |
| PubChem ID | 24896196 |
| MDL Number | MFCD00064193 |
| SMILES | [Na+].CC(C)CC(=O)C([O-])=O |
| InChI | 1S/C6H10O3.Na/c1-4(2)3-5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChI Key | IXFAZKRLPPMQEO-UHFFFAOYSA-M |
| Beilstein/REAXYS | 4239297 |
| NACRES Code | NA.25 |
| UNSPSC | 12352107 |
| MSDS | msds/173858_1_93778_31_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-METHYL-4-PENTENOIC ACID | 1575-74-2 | 2A-1173546 |
| TETRONIC ACID | 4971-56-6 | 2A-1173547 |
| 1,4-bis(4-nitrophenyl)butane-1,4-dione | 108791-66-8 | 2A-1173550 |
| 2-Fluoro-6-nitro-N-phenylbenzamide | 870281-83-7 | 2A-1173551 |
| 4-Bromo-2-fluoro-N-methylbenzamide | 749927-69-3 | 2A-1173552 |
| 2-(Tetradecylthio)propanoic acid | 214491-16-4 | 2A-1173555 |
| calcium di-beta-alaninate | 36321-40-1 | 2A-1173556 |
| L- Arginine Nitrate | 223253-05-2 | 2A-1173557 |
| Poly(9,9-dioctyl-9H-fluorene-2,7-diyl) | 195456-48-5 | 2A-1173558 |
| 2,3,5,6-tetrakis(3,6-di-t-Butylcarbazol-9-yl)-1,4-dicyanobenzene | 2A-1173559 | 2A-1173559 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA