
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1940-44-9 |
| Catalog No. | 2A-1173432 |
| Chinese Name | 4-溴-2,3-二氯苯酚 |
| Synonyms | 4-BROMO-2,3-DICHLORO-PHENOL; Phenol,4-bromo-2,3-dichloro; AR2720 |
| Molecular Formula | C6H3O1Cl2Br1 |
| Molecular Weight | 241.9 |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2908199090 |
| PubChem ID | 39218683 |
| MDL Number | MFCD00152292 |
| SMILES | Oc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C6H3BrCl2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
| InChI Key | UQNKSTVBQXFSDQ-UHFFFAOYSA-N |
| MSDS | msds/173734_1_1940_44_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Stannane, tributyl[(phenylmethoxy)methyl]- | 66222-28-4 | 2A-1173423 |
| (E)-2-(3-METHOXY-1-PROPEN-1-YL)-4 4 5 5& | 165059-42-7 | 2A-1173424 |
| ZEFYTFQUBRZHRZ-ONEGZZNKSA-N | 1263814-90-9 | 2A-1173428 |
| Potassium 2-methyl-1-propenyltrifluoroborate | 1134643-87-0 | 2A-1173429 |
| 6-Bromo-2,3-dichlorophenol | 1940-45-0 | 2A-1173431 |
| 2-(Tributylstannyl)acrylic Acid Methyl Ester | 124582-37-2 | 2A-1173435 |
| Potassium (acetoxymethyl)trifluoroborate | 910251-35-3 | 2A-1173437 |
| N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate | 4013-98-3 | 2A-1173447 |
| 4H-1,3,5-Thiadiazin-4-one, tetrahydro-3-(1-Methylethyl)-2-[(1-Methylethyl)iMino]-5-phenyl- | 69327-75-9 | 2A-1173449 |
| N-(2-CYANOETHYL)-PHTHALIMIDE | 3589-45-5 | 2A-1173450 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA