
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 457061-31-3 |
| Catalog No. | 2A-1173250 |
| Chinese Name | 2-氟-4-(三正丁基锡)吡啶 |
| Synonyms | PC8518; 4-(Tributylstannyl)-2-fluoropyridine; 2-Fluoro-4-(tributylstannyl)pyridine |
| Molecular Formula | C17H30FNSn |
| Molecular Weight | 386.12600 |
| Storage Condition | Room temperature, filled with argon |
| HTC | 2933399090 |
| PubChem ID | 28936819 |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccnc(F)c1 |
| InChI | InChI=1S/C5H3FN.3C4H9.Sn/c6-5-3-1-2-4-7-5;3*1-3-4-2;/h2-4H;3*1,3-4H2,2H3; |
| InChI Key | YGKPEWRENKJYRP-UHFFFAOYSA-N |
| MSDS | msds/173545_2_457061_31_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Methyl-5-(tributylstannyl)thiazole | 223418-75-5 | 2A-1173243 |
| 1-METHYL-2-(TRIBUTYLSTANNYL)-1H-PYRROLE | 118486-97-8 | 2A-1173244 |
| 2-TRIBUTYLSTANNYLBENZOTHIAZOLE | 105445-58-7 | 2A-1173246 |
| 2-(TRIBUTYLSTANNYL)BENZOXAZOLE | 105494-68-6 | 2A-1173247 |
| 2-Methyl-4-(tributylstannyl)pyridine | 134914-97-9 | 2A-1173249 |
| 5-Chloro-2-(tributylstannyl)pyridine | 611168-63-9 | 2A-1173252 |
| α-D-Arabinofuranoside, 4-methylphenyl 1-thio-, 2,3,5-tribenzoate | 352438-38-1 | 2A-1173263 |
| Methyl-2,3,5-tri-O-benzoyl-alpha-D-arabinofuranoside | 7473-42-9 | 2A-1173264 |
| .alpha.-D-Arabinofuranoside, methyl | 56607-40-0 | 2A-1173265 |
| Thiotolyl beta-D-ribofuranoside | 1131610-84-8 | 2A-1173266 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA