
CAS Number2049-73-2
SynonymsResorcinol Diethyl Ether; EINECS 218-071-3; 2,6-dimethylmethoxybenzene; ethoxy-3 phenetole; Benzene,1,3-diethoxy; 1,3-diehtoxybenzene; resorcindiethylether; MFCD00015145; Benzene,3-diethoxy; m-Diethoxybenzene
Molecular FormulaC10H14O2
Molecular Weight166.21700
Density1,01 g/cm3
Boiling Point234-236 °C
Melting Point10-12 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2049-73-2 |
| Catalog No. | 2A-1172324 |
| Chinese Name | 二乙氧基苯 |
| Synonyms | Resorcinol Diethyl Ether; EINECS 218-071-3; 2,6-dimethylmethoxybenzene; ethoxy-3 phenetole; Benzene,1,3-diethoxy; 1,3-diehtoxybenzene; resorcindiethylether; MFCD00015145; Benzene,3-diethoxy; m-Diethoxybenzene |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.21700 |
| Density | 1,01 g/cm3 |
| Boiling Point | 234-236 °C |
| Melting Point | 10-12 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| PubChem ID | 71087 |
| SMILES | CCOc1cccc(OCC)c1 |
| InChI | InChI=1S/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
| InChI Key | MKGFYMKFBCWNCP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4- butylcyclohexyl)iodobenzene | 948553-77-3 | 2A-1172319 |
| 4-DIETHYLAMINOBENZONITRILE | 2873-90-7 | 2A-1172320 |
| METHYL 4-ACETOXYBENZOATE | 24262-66-6 | 2A-1172321 |
| 4-(4- pentylcyclohexyl)iodobenzene | 948553-20-6 | 2A-1172321 |
| Ethyl-5-Acetyl-2-Ethoxybenzoate | 216143-90-7 | 2A-1172322 |
| Tetrammine Palladium (II) Sulphate | 13601-06-4 | 2A-1172327 |
| SODIUM HEXACHLOROPALLADATE (IV) | 53823-60-2 | 2A-1172328 |
| 5-didehydro-5, 6-dihydro-retinoic acid | 111957-72-3 | 2A-1172329 |
| olivetolic acid | 491-72-5 | 2A-1172330 |
| EURYCOMANONE | 84633-29-4 | 2A-1172331 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA