
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37895-73-1 |
| Catalog No. | 2A-1172315 |
| Chinese Name | 4,5-二溴-1,2-二甲氧基苯 |
| Synonyms | EINECS 253-705-2; 1,2-Dibromo-4,5-dimethoxybenzene; MFCD00014894 |
| Molecular Formula | C8H8Br2O2 |
| Molecular Weight | 295.956 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 286.6±35.0 °C at 760 mmHg |
| Melting Point | 90-92℃ |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2909309090 |
| PubChem ID | 3184926 |
| SMILES | COc1cc(Br)c(Br)cc1OC |
| InChI | InChI=1S/C8H8Br2O2/c1-11-7-3-5(9)6(10)4-8(7)12-2/h3-4H,1-2H3 |
| InChI Key | ZYCLQXMMFJREPJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4- ethylcyclohexyl)bromobenzene | 2A-1172309 | 2A-1172309 |
| 3-HYDROXYFLAVONE | 577-85-5 | 2A-1172311 |
| Paeonol | 522-41-0 | 2A-1172312 |
| 5-HYDROXYFLAVONE | 491-78-1 | 2A-1172313 |
| 4-(4- ethylcyclohexyl)iodobenzene | 918826-31-0 | 2A-1172314 |
| 4-(4- propylcyclohexyl)iodobenzene | 860639-66-3 | 2A-1172316 |
| 4-(4- butylcyclohexyl)iodobenzene | 948553-77-3 | 2A-1172319 |
| 4-DIETHYLAMINOBENZONITRILE | 2873-90-7 | 2A-1172320 |
| METHYL 4-ACETOXYBENZOATE | 24262-66-6 | 2A-1172321 |
| 4-(4- pentylcyclohexyl)iodobenzene | 948553-20-6 | 2A-1172321 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA