
CAS Number170105-16-5
SynonymsImidafenacin; 4-(2-Methyl-imidazol-1-yl)-2,2-diphenyl-butyramide; Staybla; 4-(2-methyl-1-imidazolyl)-2,2-diphenylbutyramide; Imidafenacin (JAN/INN); 4-(2-Methyl-1H-imidazol-1-yl)-2,2-diphenylbutanamide; Uritos (TN); Uritos; Staybla (TN)
Molecular FormulaC20H21N3O
Molecular Weight319.400
Purity98%%
Density1.1±0.1 g/cm3
Boiling Point579.7±50.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 170105-16-5 |
| Catalog No. | 2A-1172254 |
| Chinese Name | 咪达那新 |
| Synonyms | Imidafenacin; 4-(2-Methyl-imidazol-1-yl)-2,2-diphenyl-butyramide; Staybla; 4-(2-methyl-1-imidazolyl)-2,2-diphenylbutyramide; Imidafenacin (JAN/INN); 4-(2-Methyl-1H-imidazol-1-yl)-2,2-diphenylbutanamide; Uritos (TN); Uritos; Staybla (TN) |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.400 |
| Purity | 98% |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 579.7±50.0 °C at 760 mmHg |
| Storage Condition | 2-8℃ |
| Application | Imidafenacin (KRP-197; ONO-8025) is a potent and selective M3 receptor inhibitor with a Kb value of 0.317nM and a slightly weaker Kb value for the M2 receptor. |
| PubChem ID | 11620273 |
| SMILES | Cc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O/c1-16-22-13-15-23(16)14-12-20(19(21)24,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,13,15H,12,14H2,1H3,(H2,21,24) |
| InChI Key | SQKXYSGRELMAAU-UHFFFAOYSA-N |
| Transport Info | Product name: imidazoline |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| L-SERINE-15N | 59935-32-9 | 2A-1172242 |
| 4-BIS(TRIETHOXYSILYL)BENZENE 96 | 2615-18-1 | 2A-1172247 |
| Mirodenafil Dihydrochloride | 862189-96-6 | 2A-1172249 |
| 6-(diaminomethylideneamino)hexanoic acid | 72198-14-2 | 2A-1172250 |
| INNO206 | 1361644-26-9 | 2A-1172252 |
| Lexiscan | 875148-45-1 | 2A-1172255 |
| 2-(4-Amino-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile | 614-37-85-2 | 2A-1172257 |
| 3-OXO-4-AZAANDROST-5-EEN-17-BETA-CARBONZUUR | 103335-54-2 | 2A-1172258 |
| 11beta,21-dihydroxypregna-1,4,16-triene-3,20-dione 21-acetate | 3044-42-6 | 2A-1172259 |
| Pregna-1,4-diene-3,20-dione,11,17-dihydroxy-6-methyl-, (6a,11b)- | 6870-94-6 | 2A-1172262 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA