
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28210-41-5 |
| Catalog No. | 2A-1172220 |
| Chinese Name | 聚(苯乙烯磺酸) |
| Synonyms | MFCD00165973; Tolevamer; Poly(styrene sulfonic acid) |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.21200 |
| Purity | 98.00% |
| Density | 1.11 g/mL at 25 °C |
| Boiling Point | 100°C |
| Melting Point | 1°C |
| Appearance | Liquid | Amber |
| Water Solubility | H2O: soluble |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Application | Polystyrene forms polystyrene microplastics (PS MP), a potentially toxic and hazardous material. Polystyrene microplastics are harmful to the heart of zebrafish and induce male reproductive toxicity i |
| SMILES | [Ca++].[O-][S](=O)(=O)c1ccccc1C=C |
| InChI | InChI=1S/C8H8O3S.Ca/c1-2-7-5-3-4-6-8(7)12(9,10)11;/h2-6H,1H2,(H,9,10,11);/q;+2/p-1 |
| InChI Key | InChIKey=IJBYVKWTVVYTPL-UHFFFAOYSA-M |
| Transport Info | Product Name: Poly(styrenesulfonic acid) |
| Related Products in Industrial Applications | ||
|---|---|---|
| (5-chloro-1H-indol-2-yl)methanol | 53590-47-9 | 2A-1171937 |
| (5-CHLORO-1-BENZOTHIOPHEN-3-YL)METHANOL | 306934-93-0 | 2A-1171938 |
| 1,1-BIS(4-HYDROXYPHENYL)-3,3,5-TRIMETHYLCYCLOHEXANE | 129188-99-4 | 2A-1172060 |
| 2,3-Dihyro-1H-indol-2-ylmethanol | 138969-57-0 | 2A-1172108 |
| (TRIBUTYLSTANNYL)METHANOL | 27490-33-1 | 2A-1172119 |
| 5-PHENYLCYCLOHEXANE-1,3-DIONE | 493-72-1 | 2A-1172233 |
| 3-CHLOROBENZYLIDENEACETONE | 20766-36-3 | 2A-1172323 |
| BenzeneMethanol, a-[[[2-(4-aMinophenyl)ethyl]aMino]Methyl]-, (aR)- | 391901-45-4 | 2A-1172608 |
| (alphaR)-alpha-[[[2-(4-Nitrophenyl)ethyl]amino]methyl]benzenemethanol | 223673-34-5 | 2A-1172609 |
| (3-BroMo-4-Methylphenyl)Methanol | 68120-35-4 | 2A-1173495 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA