
CAS Number29679-58-1
SynonymsFenoprofen; 2-[3-(phenyloxy)phenyl]propanoic acid; PROGESIC; 3-(4-phenoxyphenyl)propionic acid; p1316-b<br> 3-(4-phenoxyphenyl)propionic acid; UNII:RA33EAC7KY; Fenopron; Feprona; 2-(3-Phenoxyphenyl)propanoic acid
Molecular FormulaC15H14O3
Molecular Weight242.270
Purity98%%
Density1.2±0.1 g/cm3
Boiling Point381.3±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29679-58-1 |
| Catalog No. | 2A-1172199 |
| Chinese Name | 菲诺洛芬 |
| Synonyms | Fenoprofen; 2-[3-(phenyloxy)phenyl]propanoic acid; PROGESIC; 3-(4-phenoxyphenyl)propionic acid; p1316-b<br> 3-(4-phenoxyphenyl)propionic acid; UNII:RA33EAC7KY; Fenopron; Feprona; 2-(3-Phenoxyphenyl)propanoic acid |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Purity | 98% |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 381.3±25.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| Application | Fenoprofen (LILLY-53858) is a nonsteroidal anti-inflammatory drug (NSAID). Fenoprofen is used to relieve symptoms of arthritis (osteoarthritis and rheumatoid arthritis) such as inflammation, swelling, |
| PubChem ID | 9210 |
| SMILES | CC(C(=O)O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) |
| InChI Key | RDJGLLICXDHJDY-UHFFFAOYSA-N |
| Transport Info | Product name: Finoprofen |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-3-fluoropicolinic acid | 860296-21-5 | 2A-1172189 |
| L-GALACTOSE | 15572-79-9 | 2A-1172193 |
| 1,4,8,11-Tetraoxacyclotetradecane | 295-40-9 | 2A-1172195 |
| Selamectin | 220119-17-5 | 2A-1172197 |
| BETA-D-LACTOSE | 5965-66-2 | 2A-0172198 |
| Xylohexaose | 49694-21-5 | 2A-1172200 |
| Xylopentaose | 49694-20-4 | 2A-1172201 |
| 4-BROMOBENZOYL CYANIDE | 6048-21-1 | 2A-1172202 |
| (2S)-6-{[(tert-butoxy)carbonyl]amino}-2-hydroxyhexanoic acid | 111223-31-5 | 2A-1172203 |
| POTASSIUM LAURATE | 10124-65-9 | 2A-1172204 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA