
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 877-90-7 |
| Catalog No. | 2A-1172068 |
| Chinese Name | 3-氟-4-氟乙酰苯胺 |
| Synonyms | MFCD00018095; N-(3-Chloro-4-fluorophenyl)acetamide |
| Molecular Formula | C8H7ClFNO |
| Molecular Weight | 187.599 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 329.4±32.0 °C at 760 mmHg |
| Melting Point | 116-119ºC |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2924299090 |
| PubChem ID | 3140391 |
| SMILES | CC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClFNO/c1-5(12)11-6-2-3-8(10)7(9)4-6/h2-4H,1H3,(H,11,12) |
| InChI Key | ALPHMTFVUKDBGJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sulfamethoxydiazine | 18179-67-4 | 2A-1172059 |
| REICHSTEIN'S SUBSTANCE S 21-ACETATE | 640-87-9 | 2A-1172061 |
| 18-methyl-Estra-4-en-3,11,17-trione | 100071-90-7 | 2A-1172064 |
| 11A-HYDROXY-18-METHYL-ESTR-4-ENE-3,17-DIONE | 53067-82-6 | 2A-1172065 |
| 4-TERT-BUTYL-2,6-DIFORMYLPHENOL | 84501-28-0 | 2A-1172066 |
| METHYL VALERATE | 624-24-8 | 2A-1172059 |
| cornexistin | 123068-35-9 | 2A-1172072 |
| 4-(2-Methylpropoxy)benzenemethanamine acetate (1:1) | 955997-89-4 | 2A-1172079 |
| Ertugliflozin | 1210344-57-2 | 2A-1172080 |
| Ethyl 2-((5-chloropyridin-2-yl)amino)-2-oxoacetate hydrochloride | 1243308-37-3 | 2A-1172085 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA