
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58268-08-9 |
| Catalog No. | 2A-1171998 |
| Chinese Name | 2-(2-噻吩基)-1,3-二氧戊环 |
| Synonyms | 2-thiophen-2-yl-1,3-dioxolane |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.20200 |
| Purity | 98% |
| Density | 1.25 |
| Boiling Point | 111ºC / 15mmHg |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | frozen |
| HTC | 2934999090 |
| PubChem ID | 4984235 |
| SMILES | c1csc(C2OCCO2)c1 |
| InChI | InChI=1S/C7H8O2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-2,5,7H,3-4H2 |
| InChI Key | FHPFDCRNWLVVHD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1H-Pyrazole-5-carboxamide,N,1,3-trimethyl-(9CI) | 136679-01-1 | 2A-1171984 |
| 4-METHYLDIBENZOTHIOPHENE | 7372-88-5 | 2A-1171985 |
| 1H-Pyrazole-5-acetic acid, 1,3-dimethyl- | 196717-12-1 | 2A-1171986 |
| 2-[(4S)-4,5-dihydro-4-(1-Methylethyl)-2-oxazolyl]- yridine | 108915-04-4 | 2A-1171989 |
| 4-Amino-2-(trifluoromethyl)quinoline | 1700-93-2 | 2A-1171990 |
| 3-(4-FLUOROPHENYL)-1H-PYRAZOLE-4-CARBALDEHYDE | 306936-57-2 | 2A-1172000 |
| 4-Quinolinemethanol, 2,6-bis(trifluoromethyl)- | 1185292-81-2 | 2A-1172003 |
| 2,6-Bis[(4R)-benzyl-2-oxazolin-2-yl]pyridine | 365215-38-9 | 2A-1172004 |
| 6-Fluoro-4-(trifluoromethyl)quinoline-2-carboxylic acid ,97% | 596845-42-0 | 2A-1172005 |
| (+)-2,2'-METHYLENEBIS[(3AR,8AS)-3A,8A-DIHYDRO-8H-INDENO[1,2-D]OXAZOLE] | 180186-94-1 | 2A-1172006 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA