
CAS Number231285-86-2
Synonymsethyl-1-methyl-5-trifluoromethylpyrazole-4-carboxylate; 1-methyl-5-trifluoromethylpyrazole-4-carboxylic acid ethyl ester; ethyl 1-methyl-5-trifluoromethyl-1Hpyrazole-4-carboxylate; Ethyl 2-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate
Molecular FormulaC8H9F3N2O2
Molecular Weight222.16400
Purity98%%
Boiling Point8590°C at 2 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 231285-86-2 |
| Catalog No. | 2A-1171982 |
| Chinese Name | 1-甲基-5-三氟甲基-1H-吡唑-4-羧酸乙酯 |
| Synonyms | ethyl-1-methyl-5-trifluoromethylpyrazole-4-carboxylate; 1-methyl-5-trifluoromethylpyrazole-4-carboxylic acid ethyl ester; ethyl 1-methyl-5-trifluoromethyl-1Hpyrazole-4-carboxylate; Ethyl 2-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.16400 |
| Purity | 98% |
| Boiling Point | 8590°C at 2 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 3160790 |
| SMILES | CCOC(=O)c1cnn(C)c1C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O2/c1-3-15-7(14)5-4-12-13(2)6(5)8(9,10)11/h4H,3H2,1-2H3 |
| InChI Key | RQDQIVPSSDGXQU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1,2,5-Oxadiazole-3-carboxylicacid,4-amino-,methylester(9CI) | 159013-94-2 | 2A-1171952 |
| 1H-Pyrazolo[3,4-b]pyridine-5-carbonitrile | 1234616-67-1 | 2A-1171963 |
| 2,6-Bis(trifluoromethyl)-4-bromoquinoline ,97% | 35853-48-6 | 2A-1171976 |
| 5-(PYRIDIN-3-YL)-1H-PYRAZOLE-3-CARBOXYLIC ACID ETHYL ESTER | 251658-58-9 | 2A-1171978 |
| 5-(PYRIDIN-3-YL)-1H-PYRAZOLE-3-CARBOXYLIC ACID ETHYL ESTER | 88738-78-7 | 2A-1171979 |
| 1H-Pyrazole-5-carboxamide,N,1,3-trimethyl-(9CI) | 136679-01-1 | 2A-1171984 |
| 4-METHYLDIBENZOTHIOPHENE | 7372-88-5 | 2A-1171985 |
| 1H-Pyrazole-5-acetic acid, 1,3-dimethyl- | 196717-12-1 | 2A-1171986 |
| 2-[(4S)-4,5-dihydro-4-(1-Methylethyl)-2-oxazolyl]- yridine | 108915-04-4 | 2A-1171989 |
| 4-Amino-2-(trifluoromethyl)quinoline | 1700-93-2 | 2A-1171990 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA