
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 89942-63-2 |
| Catalog No. | 2A-1171888 |
| Chinese Name | 3-羟基-4-硝基苯乙酮 |
| Synonyms | 1-acetyl-3-hydroxy-4-nitrobenzene |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.14500 |
| Density | 1.38 |
| Boiling Point | 340.953ºC at 760 mmHg |
| Melting Point | 69-70ºC |
| Storage Condition | Store at room temperature, protected from light, d |
| HTC | 2914700090 |
| PubChem ID | 36748863 |
| SMILES | CC(=O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C8H7NO4/c1-5(10)6-2-3-7(9(12)13)8(11)4-6/h2-4,11H,1H3 |
| InChI Key | LHGMRIVCXMLBNA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-CHLORO-5-IODOBENZOIC ACID METHYL ESTER | 620621-48-9 | 2A-1171870 |
| 3-NITROPHENETOLE | 621-52-3 | 2A-1171871 |
| 4'-NITRO-BIPHENYL-2-YLAMINE | 6272-52-2 | 2A-1171872 |
| N-Benzyl-3-(tert-butyldimethylsilanyloxymethyl)piperid-4-one | 325486-37-1 | 2A-1171882 |
| ETHYL 2-BROMO-3-(4-METHOXYPHENYL)-3-OXO-PROPANOATE | 87943-96-2 | 2A-1171887 |
| 1-FLUOROCYCLOPROPANE-1-SULFONAMIDE | 1108658-19-0 | 2A-1171891 |
| 2,2-dichloro-N-(2,2-dimethoxyethyl)acetimidamide | 163769-71-9 | 2A-1171892 |
| 3,4-DIHYDROXY-5-METHOXYBENZOIC ACID | 3934-84-7 | 2A-1171901 |
| methyl 4-((2-benzylhydrazinyl)methyl)benzoate | 1392879-15-0 | 2A-1171904 |
| N-acetyl-N-(2-methyl-5-nitrophenyl)acetamide | 91573-24-9 | 2A-1171906 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA