
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 179113-89-4 |
| Catalog No. | 2A-1171727 |
| Chinese Name | (3,5-二氟苯基)(苯基)甲酮 |
| Synonyms | 3,5-difluorophenyl phenyl ketone; (3,5-Difluorophenyl)(phenyl)methanone; MFCD00061140; fr cf evr; 3,5-Difluorobenzophenone |
| Molecular Formula | C13H8F2O |
| Molecular Weight | 218.19900 |
| Purity | 98% |
| Density | 1.239g/cm3 |
| Boiling Point | 117°C 5mm |
| Melting Point | 57-59°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2914700090 |
| SMILES | O=C(c1ccccc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H8F2O/c14-11-6-10(7-12(15)8-11)13(16)9-4-2-1-3-5-9/h1-8H |
| InChI Key | PNRLNUIMFIMZLI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Benzyl-pyrimidin-4-ylamine | 22404-44-0 | 2A-1171702 |
| 1H,1H,1H-PENTADECAFLUORO-2-NONANONE | 754-85-8 | 2A-1171704 |
| ASIALOGANGLIOSIDE-GM1 | 71012-19-6 | 2A-1171706 |
| 1,1,7-trichloro-1-hepten-3-one | 158355-41-0 | 2A-1171708 |
| DODECYLBENZENE | 123-01-3 | 2A-1171709 |
| (6R,7S)-Cefodizime | 2A-1171750 | 2A-1171750 |
| 7E-Cefodizime | 2A-1171751 | 2A-1171751 |
| △3-Cefodizime | 2A-1171752 | 2A-1171752 |
| Cefodizime Dimer | 2A-1171760 | 2A-1171760 |
| Cefmetazole MMT Isomer | 2A-1171761 | 2A-1171761 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA