
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53088-69-0 |
| Catalog No. | 2A-1171697 |
| Chinese Name | 3-甲基苯乙酸甲酯 |
| Synonyms | methyl 2-(3-methylphenyl)acetate; Methyl 3-methylphenylacetate; MFCD00968468 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20100 |
| Density | 1.035g/cm3 |
| Boiling Point | 226.9ºC at 760 mmHg |
| Appearance | Liquid | Clear colorless to slightly yellow |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2916399090 |
| PubChem ID | 7616862 |
| SMILES | COC(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C10H12O2/c1-8-4-3-5-9(6-8)7-10(11)12-2/h3-6H,7H2,1-2H3 |
| InChI Key | InChIKey=AWTKFTNNPQGGLX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| GSK-2881078 | 1539314-06-1 | 2A-1171688 |
| N/A | 16900-79-1 | 2A-1171689 |
| sodium,8-[(2-hydroxybenzoyl)amino]octanoate | 203787-91-1 | 2A-1171690 |
| ACIBENZOLAR ACID | 35272-27-6 | 2A-1171691 |
| Butoxyl glycerol | 98451-40-2 | 2A-1171695 |
| N-[(EthylaMino)thioxoMethyl]-N'-phenylpropaniMidaMide | 263137-35-5 | 2A-1171699 |
| BIBW2992 DiMaleate | 850140-73-7 | 2A-1171700 |
| dimethyl 2-methyl-5-methyleneadipate | 4513-62-6 | 2A-1171701 |
| 2-Benzyl-pyrimidin-4-ylamine | 22404-44-0 | 2A-1171702 |
| 1H,1H,1H-PENTADECAFLUORO-2-NONANONE | 754-85-8 | 2A-1171704 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA