
CAS Number52899-69-1
Synonyms4-carboxyphenyl-4-methoxybenzoate; 4-Anisoyloxy-benzoesaeure; 4-(4-methoxy-benzoyloxy)-benzoic acid; Benzoic acid,4-methoxy-,4-carboxyphenyl ester; 4-(4-Methoxy-benzoyloxy)-benzoesaeure
Molecular FormulaC15H12O5
Molecular Weight272.25300
PurityGC>99%%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52899-69-1 |
| Catalog No. | 2A-1171580 |
| Chinese Name | 4-(4-methoxybenzoyl)oxybenzoic acid |
| Synonyms | 4-carboxyphenyl-4-methoxybenzoate; 4-Anisoyloxy-benzoesaeure; 4-(4-methoxy-benzoyloxy)-benzoic acid; Benzoic acid,4-methoxy-,4-carboxyphenyl ester; 4-(4-Methoxy-benzoyloxy)-benzoesaeure |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25300 |
| Purity | GC>99% |
| HTC | 2918990090 |
| PubChem ID | 33260026 |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H12O5/c1-19-12-6-4-11(5-7-12)15(18)20-13-8-2-10(3-9-13)14(16)17/h2-9H,1H3,(H,16,17) |
| InChI Key | FDCMZOYSEHNDCP-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| hydrogenchloride [4-[2- (dimethylamino)ethoxy]phenyl]p henylmethanone | 95825-80-2 | 2A-1171574 |
| 4-(trans-4-methylcyclohexyl)cyclohexanone | 151772-66-6 | 2A-1171576 |
| trans-4′-Ethyl-1,1′-bicyclohexyl-4-on | 150763-46-5 | 2A-1171577 |
| 6-amino-4-hydroxy-2-methylnicotinic acid | 2A-1171578 | 2A-1171578 |
| DWK-1339 | 1018946-38-7 | 2A-1171579 |
| 2-CHLORO-1,1,2-TRIFLUOROETHYL ETHYL ETHER | 310-71-4 | 2A-1171581 |
| ETHYL CHLOROFLUOROACETATE | 401-56-9 | 2A-1171582 |
| ETHYL IODOFLUOROACETATE | 401-58-1 | 2A-1171583 |
| 1-PHENYLCYCLOPENTENE | 825-54-7 | 2A-1171586 |
| 2-(4-propylcyclohexyl)propane-1,3-diol | 852613-14-0 | 2A-1171588 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA