
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 101366-61-4 |
| Catalog No. | 2A-1171494 |
| Chinese Name | 3-(4-羟甲基苯)丙酸 |
| Synonyms | MFCD00137851 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20000 |
| Density | 1.266±0.06 g/cm3(Predicted) |
| Boiling Point | 365.8ºC at 760mmHg |
| Melting Point | 148-152ºC |
| Storage Condition | Store at 0-5°C |
| HTC | 2918990090 |
| SMILES | O=C(O)CCOc1ccc(CO)cc1 |
| InChI | InChI=1S/C10H12O4/c11-7-8-1-3-9(4-2-8)14-6-5-10(12)13/h1-4,11H,5-7H2,(H,12,13)/p-1 |
| InChI Key | WPWKJUVXEMKOHS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine | 324017-22-3 | 2A-1171481 |
| 2-((9-Oxo-9H-xanthen-3-yl)oxy)acetic acid | 25363-95-5 | 2A-1171489 |
| 4-ACETOXYMETHYLBENZOIC ACID | 102370-08-1 | 2A-1171491 |
| 5-(4-formyl-3,5-dimethoxyphenoxy)pentanoic acid | 115109-59-6 | 2A-1171492 |
| 5-(4-Hydromethyl-3,5-dimethoxyphenoxy)pentanoic acid | 134020-55-6 | 2A-1171493 |
| 4-HYDROXY-2-METHOXYBENZYL ALCOHOL | 119138-29-3 | 2A-1171495 |
| 4-(4-HYDROXYMETHYL-3-METHOXYPHENOXY)-BUTYRIC ACID | 136849-75-5 | 2A-1171498 |
| ONC212 | 1807861-48-8 | 2A-1171507 |
| 3-(methylamino)butan-1-ol | 2704-55-4 | 2A-1171509 |
| H-THR-OBZL OXALATE (1:1) | 201274-07-9 | 2A-1171512 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA