
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1266322-58-0 |
| Catalog No. | 2A-1171096 |
| Chinese Name | 7-溴喹啉-3-胺 |
| Synonyms | 7-bromoquinolin-3-amine |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.06900 |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 122733062 |
| InChI | InChI=1S/C9H7BrN2/c10-7-2-1-6-3-8(11)5-12-9(6)4-7/h1-5H,11H2 |
| InChI Key | CCHYPYCCQBLGLJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| UUMDVWHEIMROHJ-VBKFSLOCSA-N | 1402390-77-5 | 2A-1171083 |
| AT13148 intermediate(N1) | 1056901-64-4 | 2A-1171086 |
| 3-(tetrahydro-2H-pyran-2-yloxy) propanoic acid | 1221443-23-7 | 2A-1171090 |
| 2-BroMo-5-Fluoroterephthalic acid | 1245807-64-0 | 2A-1171093 |
| (3,3-Difluorocyclobutyl)methanamine hydrochloride | 1159882-59-3 | 2A-1171094 |
| 1-(benzo[d][1,3]dioxol-5-yl)pentan-1-one | 63740-98-7 | 2A-1171098 |
| PLATINUM(IV) OXIDE HYDRATE | 12137-21-2 | 2A-0202266 |
| 2,3-DIMETHOXYANILINE | 6299-67-8 | 2A-1171103 |
| Potassium (cyanomethyl)trifluoroborate | 888711-58-8 | 2A-1171105 |
| 2-ISOPROPOXY-4,4,6-TRIMETHYL-[1,3,2]DIOXABORINANE | 61676-61-7 | 2A-1171108 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA