
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1003709-39-4 |
| Catalog No. | 2A-1170910 |
| Chinese Name | 2-溴-4-氟-5-甲基苯甲酸 |
| Synonyms | 2-Bromo-4-fluoro-5-methylbenzoic acid; x4311 |
| Molecular Formula | C8H6BrFO2 |
| Molecular Weight | 233.034 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 309.0±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| PubChem ID | 91746876 |
| InChI | InChI=1S/C8H6BrFO2/c1-4-2-5(8(11)12)6(9)3-7(4)10/h2-3H,1H3,(H,11,12) |
| InChI Key | UVSGTNJGIMPLAM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-CHLORO-3-NITROBENZOPHENONE | 51067-02-9 | 2A-1170901 |
| Methyl 4-forMyl-2-Methylbenzoate | 74733-23-6 | 2A-1170904 |
| ACETYL CHLORIDE-13C2 | 89186-79-8 | 2A-1170905 |
| 7-Chlorokynurenic acid sodium salt | 1263094-00-3 | 2A-1170907 |
| 1,3-Bis(2,6-di-i-propylphenyl)-4,5-dihydroimidazol-2-ylidine | 258278-28-3 | 2A-1170908 |
| 8-aminoquinolin-3-ol,93% | 25369-38-4 | 2A-1170916 |
| 3,6-diethyl-1,2-Benzenedicarbonitrile | 125773-94-6 | 2A-1170917 |
| 8-nitroquinolin-3-ol | 25369-37-3 | 2A-1170918 |
| POTASSIUM BUTYLTRIFLUOROBORATE | 444343-55-9 | 2A-1170921 |
| Potassium tert-butoxymethyltrifluoroborate | 910251-10-4 | 2A-1170922 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA