
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 134523-01-6 |
| Catalog No. | 2A-1170827 |
| Chinese Name | 阿伐他汀钠 |
| Synonyms | Atorvastatin Sodium; atorvastatin sodium salt; 3R,5R-Atorvastaatin Sodium salt |
| Molecular Formula | C33H34FN2NaO5 |
| Molecular Weight | 580.62 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 722.2±60.0ºC at 760 mmHg |
| Application | Atorvastatin sodium is an orally active HMG-CoA reductase inhibitor with the ability to effectively lower blood lipids. Atorvastatin sodium inhibits human SV-SMC proliferation and invasion, with IC50 |
| PubChem ID | 16694773 |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C33H35FN2O5.Na/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);/q;+1/p-1/t26-,27-;/m1./s1 |
| InChI Key | VVRPOCPLIUDBSA-CNZCJKERSA-M |
| Transport Info | Product name: Atorvastatin-d5 sodium salt |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Trandolaprilat Hydrate | 951393-55-8 | 2A-1170715 |
| Erdafitinib (JNJ-42756493) | 1346242-81-6 | 2A-1170731 |
| Dehydro Simvastatin | 210980-68-0 | 2A-1170753 |
| Norfloxacin Lactate Injection | 2A-1170770 | 2A-1170770 |
| Ganciclovir Mono-O-acetate | 88110-89-8 | 2A-1170805 |
| 2-Desethyl-2-propylazithromycin | 763924-54-5 | 2A-1170837 |
| trans-Abacavir Hydrochloride | 267668-71-3 | 2A-1170856 |
| Abacavir sulfate | 188062-50-2 | 2A-1170857 |
| Abacavir Carboxylate | 384380-52-3 | 2A-1170858 |
| Abacavir 5'-Glucuronide | 384329-76-4 | 2A-1170859 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA