
CAS Number75-46-7
SynonymsFron23; FE13; Fluoryl; MFCD00000446; FC-13; CHF3; trifluoromethane acid; CFC23; HCFC23; EINECS 200-872-4; R-23; Trifluoromethane; arcton1; HFC-23
Molecular Formula(CF3SO2)2NH
Molecular Weight281.15
Purity≥95.0 (<SUP>19</SUP>F-NMR)%
Density1.246
Boiling Point−84 °C(lit.)
Melting Point52-56 °C
Appearancesolid
Symbol
Signal WordWarning
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75-46-7 |
| Catalog No. | 2A-9017089 |
| Chinese Name | 三氟甲烷 |
| Synonyms | Fron23; FE13; Fluoryl; MFCD00000446; FC-13; CHF3; trifluoromethane acid; CFC23; HCFC23; EINECS 200-872-4; R-23; Trifluoromethane; arcton1; HFC-23 |
| Molecular Formula | (CF3SO2)2NH |
| Molecular Weight | 281.15 |
| Purity | ≥95.0 (<SUP>19</SUP>F-NMR) |
| Density | 1.246 |
| Boiling Point | −84 °C(lit.) |
| Melting Point | 52-56 °C |
| Appearance | solid |
| Water Solubility | slightly |
| Storage Condition | Storage precautions: Store in a cool, ventilated, |
| HTC | 2903399090 |
| PubChem ID | 329750774 |
| MDL Number | MFCD00214154 |
| SMILES | FC(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | 1S/C2HF6NO4S2/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9H |
| InChI Key | ZXMGHDIOOHOAAE-UHFFFAOYSA-N |
| Beilstein/REAXYS | 4754101 |
| NACRES Code | NA.22 |
| UNSPSC | 12352101 |
| Hazard Symbols | 2.2 |
| MSDS | msds/17089_1_75_46_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903399090. Brominated, fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloropropane | 75-29-6 | 2A-9017080 |
| 2-Propanethiol | 75-33-2 | 2A-9017083 |
| Difluoroethane | 75-37-6 | 2A-9017086 |
| Dichloromonofluoromethane | 75-43-4 | 2A-9017087 |
| Difluorochloromethane | 75-45-6 | 2A-9017088 |
| Iodoform | 75-47-8 | 2A-9017090 |
| Tetramethylammonium iodide | 75-58-1 | 2A-9017096 |
| Cacodylic acid | 75-60-5 | 2A-9017098 |
| Dibromodifluoromethane | 75-61-6 | 2A-9017099 |
| Bromotrichloromethane | 75-62-7 | 2A-9017100 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA