
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 267651-23-0 |
| Catalog No. | 2A-1170664 |
| Chinese Name | 3'-溴-2'-甲氧基苯乙酮 |
| Synonyms | 1-(3-Bromo-2-methoxyphenyl)ethanone |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.071 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 290.5±25.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2914700090 |
| PubChem ID | 141211380 |
| SMILES | COc1c(Br)cccc1C(C)=O |
| InChI | InChI=1S/C9H9BrO2/c1-6(11)7-4-3-5-8(10)9(7)12-2/h3-5H,1-2H3 |
| InChI Key | IBHCVANJIBGASI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-NITROCHRYSENE | 7496-02-8 | 2A-1170657 |
| OSW-1 | 145075-81-6 | 2A-1170659 |
| GADOBUTROL | 770691-21-9 | 2A-1170660 |
| germicidin | 151271-57-7 | 2A-1170662 |
| Tafenoquine Succinate | 178429-62-4 | 2A-1170663 |
| LaidloMycin propionate potassiuM | 84799-02-0 | 2A-1170665 |
| Rebaudioside D | 63279-13-0 | 2A-1170666 |
| Rebaudioside M | 1220616-44-3 | 2A-1170667 |
| Ethanone, 1-(3-methyl-1-oxido-2-quinoxalinyl)- | 61522-57-4 | 2A-1170671 |
| 1-(3-METHYLQUINOXALIN-2-YL)ETHANONE | 22059-64-9 | 2A-1170673 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA