
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4657-56-1 |
| Catalog No. | 2A-1170428 |
| Chinese Name | 4-氯-2-醛基苯甲酸 |
| Synonyms | 2-formyl-4-chlorobenzoic acid; Benzoic acid,4-chloro-2-formyl |
| Molecular Formula | C8H5ClO3 |
| Molecular Weight | 184.57600 |
| Purity | 98.00 |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 16106310 |
| SMILES | O=Cc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C8H5ClO3/c9-6-1-2-7(8(11)12)5(3-6)4-10/h1-4H,(H,11,12) |
| InChI Key | UAEFASLCDWQSDH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-BroMo-1,5-naphthyridin-2(1H)-one | 959616-36-5 | 2A-1170413 |
| 4-broMo-8-Methoxynaphthalen-1-ol | 184221-86-1 | 2A-1170414 |
| ethyl alaninate | 3082-75-5 | 2A-1170420 |
| mersacidin | 128104-18-7 | 2A-1170423 |
| 5-Nitroso-salicylate | 15516-60-6 | 2A-1170424 |
| N,N'-THIO-BIS(PHTHALIMIDE) | 7764-29-6 | 2A-1170430 |
| Nsc163496 | 1049-84-9 | 2A-1170432 |
| 7-isopropyl-1,3-dihydro-2H-indol-2-one | 1260788-68-8 | 2A-1170433 |
| DINONYL-AMINE | 2044-21-5 | 2A-1170434 |
| 2-methyl-6-methyleneocta-2,7-dien-4-ol | 14434-41-4 | 2A-1170433 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA