
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79183-19-0 |
| Catalog No. | 2A-1170403 |
| Chinese Name | MDK83190 |
| Synonyms | Apoptosis Activator 2; Apoptosis Activator II; Tocris-2098; 1-(3,4-Dichlorobenzyl)-1H-indole-2,3-dione |
| Molecular Formula | C15H9Cl2NO2 |
| Molecular Weight | 306.143 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 470.6±55.0 °C at 760 mmHg |
| Appearance | orange solid |
| Storage Condition | Store at RT |
| Application | Apoptosis Activator 2 is an effective activator of apoptosis, which can promote the processing of procaspase-9 and activate caspase-3. |
| HTC | 29145090 |
| PubChem ID | 3197032 |
| SMILES | O=C1C(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C15H9Cl2NO2/c16-11-6-5-9(7-12(11)17)8-18-13-4-2-1-3-10(13)14(19)15(18)20/h1-7H,8H2 |
| InChI Key | KGRJPLRFGLMQMV-UHFFFAOYSA-N |
| Transport Info | Product name: 1-(3,4-dichlorobenzyl)-1H-indole-2,3-dione |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Pyridinepropanamine,N,N-dimethyl-g-phenyl-,hydrochloride (1:1) | 25332-09-6 | 2A-1170374 |
| 3-Cyano-1-azetidinesulfonylchloride | 1310734-08-7 | 2A-1170382 |
| 5-BroMo-7-Methyl-7H-pyrrolo[2,3-d]pyriMidin-4-aMine | 1337532-51-0 | 2A-1170388 |
| 2-Benzothiazolesulfonicacid(6CI,7CI,8CI,9CI) | 941-57-1 | 2A-1170389 |
| 4-[3-Oxo-3-(2-oxo-2,3-dihydrobenzoxazol-6-yl)propyl]piperazine-1-carboxylic acid 3,5-dichlorobenzyl ester | 1144035-53-9 | 2A-1170397 |
| 2-Trifluoromethyl-pyrimidine-5-carboxylic acid methyl ester | 608515-90-8 | 2A-1170415 |
| Pyrimidine, 5-(bromomethyl)-2-(trifluoromethyl)- (9CI) | 198404-35-2 | 2A-1170416 |
| 4-Methyl-2-(trifluoroMethyl)pyriMidine | 1017464-05-9 | 2A-1170417 |
| 5-Chloro-1-(3H)-Isobenzofuranone | 54109-03-4 | 2A-1170427 |
| 1-(4-vinylbenzyl)pyrrolidine | 60472-54-0 | 2A-1170451 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA