
CAS Number955365-80-7
Synonyms2-allyl-1,8-dimethoxy-9,10-anthraquinone; 9,10-Anthracenedione,1,8-dimethoxy-2-(2-propenyl); 2-allyl-1,8-dimethoxyanthracene-9,10-dione; MK-1775; MK1775; AZD1775
Molecular FormulaC27H32N8O2
Molecular Weight500.595
Density1.3±0.1 g/cm3
Boiling Point723.8±70.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 955365-80-7 |
| Catalog No. | 2A-1170345 |
| Chinese Name | Adavosertib (MK-1775) |
| Synonyms | 2-allyl-1,8-dimethoxy-9,10-anthraquinone; 9,10-Anthracenedione,1,8-dimethoxy-2-(2-propenyl); 2-allyl-1,8-dimethoxyanthracene-9,10-dione; MK-1775; MK1775; AZD1775 |
| Molecular Formula | C27H32N8O2 |
| Molecular Weight | 500.595 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 723.8±70.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| Application | Adavosertib (AZD-1775; MK-1775) is a potent Wee1 inhibitor with an IC50 of 5.2 nM. |
| PubChem ID | 50087297 |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C27H32N8O2/c1-5-13-34-25(36)21-18-28-26(29-19-9-11-20(12-10-19)33-16-14-32(4)15-17-33)31-24(21)35(34)23-8-6-7-22(30-23)27(2,3)37/h5-12,18,37H,1,13-17H2,2-4H3,(H,28,29,31) |
| InChI Key | BKWJAKQVGHWELA-UHFFFAOYSA-N |
| Transport Info | Product name: MK-1775 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| GW 627368X | 439288-66-1 | 2A-1170337 |
| LY 2874455 | 1254473-64-7 | 2A-1170341 |
| LY 2784544 | 1229236-86-5 | 2A-1170342 |
| BLU 9931 | 1538604-68-0 | 2A-1170343 |
| TP0903 | 1341200-45-0 | 2A-1170344 |
| BD 1047 dihydrobromide | 138356-21-5 | 2A-1170348 |
| LY-2484595 | 1186486-62-3 | 2A-1170349 |
| Sb-742457 | 607742-69-8 | 2A-1170350 |
| RQ-00203078 | 1254205-52-1 | 2A-1170353 |
| KEVETRIN | 500863-50-3 | 2A-1170354 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA