
CAS Number2840-61-1
Synonyms3-Methyl-5-oxo-5-phenylpentansaeure; 3-Methyl-5-oxo-5-phenylpentanoic acid; 3-methy-5-oxo-5-phenylpentanoic acid; 3-Methyl-5-oxo-5-phenylvaleric acid; 3-Methyl-5-oxo-5-phenyl-valeriansaeure
Molecular FormulaC12H14O3
Molecular Weight206.238
Purity98%%
Density1.1±0.1 g/cm3
Boiling Point382.7±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2840-61-1 |
| Catalog No. | 2A-1170072 |
| Chinese Name | 3-methy-5-oxo-5-phenylpentanoic acid |
| Synonyms | 3-Methyl-5-oxo-5-phenylpentansaeure; 3-Methyl-5-oxo-5-phenylpentanoic acid; 3-methy-5-oxo-5-phenylpentanoic acid; 3-Methyl-5-oxo-5-phenylvaleric acid; 3-Methyl-5-oxo-5-phenyl-valeriansaeure |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Purity | 98% |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 382.7±25.0 °C at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 3187575 |
| SMILES | CC(CC(=O)O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-9(8-12(14)15)7-11(13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,15) |
| InChI Key | DGKMKGNXHZXIKE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CYCLO(-LEU-GLY) | 5845-67-0 | 2A-1170065 |
| H-His(Trt)-OMe · HCl | 32946-56-8 | 2A-1170067 |
| N-alpha-t-Butyloxycarbonyl-N-epsilon-benzyloxycarbonyl-L-lysinol | 82689-20-1 | 2A-1170069 |
| 2-(BENZYLOXY)-1-ETHANAMINE HYDROCHLORIDE | 10578-75-3 | 2A-1170070 |
| (4-formyl-1H-[1,2,3]-triazol-1-yl)methyl pivalate | 1423037-50-6 | 2A-1170071 |
| Carbamic acid, [(1R)-2-cyano-1-methylethyl]-, 1,1-dimethylethyl ester (9CI) | 170367-68-7 | 2A-1170073 |
| Z-LEU-LEU-GLU-AMC | 348086-66-8 | 2A-1170076 |
| N-Me-Hyp-OH·HCl | 89771-43-7 | 2A-1170079 |
| L-2-(5-Bromothienyl)alanine | 154593-58-5 | 2A-1170080 |
| 2-AMINO-3,5-DIBROMOBENZYL ALCOHOL | 50739-76-9 | 2A-1170084 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA