
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 885281-27-6 |
| Catalog No. | 2A-1170016 |
| Chinese Name | (2-氨基-1-甲基-1H-咪唑-5-基)甲醇 |
| Synonyms | (2-Amino-1-methyl-1H-imidazol-5-yl)methanol |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.145 |
| Purity | 98% |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 373.6±34.0 °C at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2933290090 |
| PubChem ID | 132576021 |
| SMILES | Cn1c(CO)cnc1N |
| InChI | InChI=1S/C5H9N3O/c1-8-4(3-9)2-7-5(8)6/h2,9H,3H2,1H3,(H2,6,7) |
| InChI Key | BQRWIUDGCNMEEQ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| Thioplast G-4 Liquid polysulfide polymer- thiol terminated, product outside EU | 2A-1169945 | 2A-1169945 |
| Unoxol Diol, Bis(hydroxymethyl)cyclohexane, 1,3- and 1,4-cis/trans-isomers, Cyclohexane-dimethanol | 2A-1169946 | 2A-1169946 |
| Pluriol A 5010 PH, Methylpolyethylene glycol identical to Pluriol A 5010 E | 2A-1169955 | 2A-1169955 |
| CYCLOHEXANE | 608-80-0 | 2A-1169972 |
| 5-chloro-2-nitrotoluene | 5367-29-2 | 2A-1169981 |
| 1,2-Dilauroyl-sn-Glycero-3-PhosphatidylethanolaMine | 42436-56-6 | 2A-1170048 |
| 2-MORPHOLIN-4-YL-2-OXOETHANOL | 51068-78-1 | 2A-1170340 |
| (5-AMino-1H-pyrazol-3-yl)Methanol | 1000895-26-0 | 2A-1170381 |
| BENZYL 4-TOLUENESULFONATE | 1024-41-5 | 2A-1170425 |
| 3-FLUORO-4-NITROTOLUENE | 128446-34-4 | 2A-1170477 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA