
CAS Number74317-53-6
SynonymsRhB hydrazide; N-(rhodamine-B)hydrazide; 2-amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one; 2-amino-12,15-bis(diethylamino)spiro[isoindoline-3,9'-xanthene]-1-one; hydrazine rhodamine; N-(rhodamine-B) lactam-hydrazine; Rhodamine B hydrazide
Molecular FormulaC28H32N4O2
Molecular Weight456.58
Purity98%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74317-53-6 |
| Catalog No. | 2A-1169753 |
| Chinese Name | 罗丹明B酰肼 |
| Synonyms | RhB hydrazide; N-(rhodamine-B)hydrazide; 2-amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one; 2-amino-12,15-bis(diethylamino)spiro[isoindoline-3,9'-xanthene]-1-one; hydrazine rhodamine; N-(rhodamine-B) lactam-hydrazine; Rhodamine B hydrazide |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.58 |
| Purity | 98 |
| Storage Condition | 2~8°C |
| Application | Rhodamine B hydrazide is a good sulfite probe with colorless and non-fluorescent properties. Emissions are related to sulfite concentration (5-800 ng/mL; detection limit = 1.4 ng/mL (3σ)). Sulfite red |
| PubChem ID | 6163641 |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1N |
| InChI | InChI=1S/C28H32N4O2/c1-5-30(6-2)19-13-15-23-25(17-19)34-26-18-20(31(7-3)8-4)14-16-24(26)28(23)22-12-10-9-11-21(22)27(33)32(28)29/h9-18H,5-8,29H2,1-4H3 |
| InChI Key | WTDHTIVYKKLOTC-UHFFFAOYSA-N |
| Transport Info | Product name: Rhodamine B hydrazide |
| Related Products in Pigments & Additives | ||
|---|---|---|
| BASIC BLUE 24 | 1934-16-3 | 2A-1168948 |
| DISPERSE RED 19 | 2734-52-3 | 2A-1168957 |
| 2-(2-aminoethyl) Rhodamine B amide | 950846-89-6 | 2A-1169119 |
| 1 9-DIMETHYLMETHYLENE BLUE CHLORIDE | 931418-92-7 | 2A-1169453 |
| 5(6)-CARBOXY-X-RHODAMINE FOR FLUOR- | 198978-94-8 | 2A-1169684 |
| Acid Yellow 127 | 73384-78-8 | 2A-1169800 |
| Acid yellow 137 | 72827-84-0 | 2A-1169801 |
| Acid Yellow 199 | 70865-20-2 | 2A-1169803 |
| Acid Yellow 220 | 71603-79-7 | 2A-1169805 |
| C.I. Acid Yellow 232 | 134687-50-6 | 2A-1169806 |
| Browse all Pigments & Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA