
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 36772-98-2 |
| Catalog No. | 2A-1169646 |
| Chinese Name | 2,6-Dibromo-4-acetylresorcinol |
| Synonyms | 1-(3,5-Dibrom-2,4-dihydroxy-phenyl)-aethanon; 2,6-Dibromo-4-acetylresorcinol; 1-(3,5-dibromo-2,4-dihydroxy-phenyl)-ethanone |
| Molecular Formula | C8H6Br2O3 |
| Molecular Weight | 309.93900 |
| Purity | 98 |
| HTC | 2914700090 |
| PubChem ID | 3351466 |
| SMILES | CC(=O)c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C8H6Br2O3/c1-3(11)4-2-5(9)8(13)6(10)7(4)12/h2,12-13H,1H3 |
| InChI Key | AXKQYRSCSPGWBY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-bis(benzyloxy)phenol | 27688-86-4 | 2A-1169635 |
| Methoxydithioformic acid methyl ester | 19708-81-7 | 2A-1169636 |
| 3-cyano-2-phenylpropanoic acid | 442542-97-4 | 2A-1169639 |
| 3-(propionyloxy)benzoic acid | 51988-36-4 | 2A-1169641 |
| N,N-DI-N-BUTYLACETAMIDE | 1563-90-2 | 2A-1169643 |
| Methyl 2-(2-bromo-4-fluorophenyl)acetate | 949168-34-7 | 2A-1169648 |
| 1,4-Cyclohexadiene-1,4-dicarboxylicacid, 2,5-dihydroxy-, 1,4-diethyl ester | 16877-79-5 | 2A-1169650 |
| 4,5-Dichloro-2-(tetrahydro-pyran-2-yl)-2H-pyridazin-3-one | 173206-13-8 | 2A-1169651 |
| tert-butyl (1-hydrazinyl-1-oxopropan-2-yl)carbaMate | 41863-52-9 | 2A-1169652 |
| Nsc119463 | 1848-24-4 | 2A-1169655 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA