
CAS Number72235-51-9
Synonyms(2,3-difluorophenyl)methanamine; 2,3-Difluorobenzylamine; 2,3-Difluorobenzenemethylamine; 2,3-Difluorobenzenemethanamine; MFCD00070793; 1-(2,3-Difluorophenyl)methanamine; 1-(2,3-Difluorophenyl)methylamine; Z1R BF CF
Molecular FormulaC7H7F2N
Molecular Weight143.134
Purity97%
Density1.2±0.1 g/cm3
Boiling Point178.6±25.0 °C at 760 mmHg
Melting Point31ºC
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72235-51-9 |
| Catalog No. | 2A-9001697 |
| Chinese Name | 2,3-二氟苄胺 |
| Synonyms | (2,3-difluorophenyl)methanamine; 2,3-Difluorobenzylamine; 2,3-Difluorobenzenemethylamine; 2,3-Difluorobenzenemethanamine; MFCD00070793; 1-(2,3-Difluorophenyl)methanamine; 1-(2,3-Difluorophenyl)methylamine; Z1R BF CF |
| Molecular Formula | C7H7F2N |
| Molecular Weight | 143.134 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 178.6±25.0 °C at 760 mmHg |
| Melting Point | 31ºC |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | III |
| HTC | 2921499090 |
| UN(IATA) | UN 2735 |
| SMILES | NCc1cccc(F)c1F |
| InChI | InChI=1S/C7H7F2N/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2/p+1 |
| InChI Key | OHZUCDHZOHSBPZ-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Risk Codes | R34 |
| Safety Description | S26;S27;S36/37/39;S45 |
| MSDS | msds/1697_1_72235_51_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Difluorobenzamide | 18355-75-4 | 2A-9001692 |
| 2,3-Difluorobenzonitrile | 21524-39-0 | 2A-9001693 |
| 2,3-Difluorobenzoyl chloride | 18355-73-2 | 2A-9001694 |
| 2,3-Difluorobenzyl alcohol | 75853-18-8 | 2A-9001695 |
| 2,3-Difluorobenzyl bromide | 113211-94-2 | 2A-9001696 |
| 2,3-Difluorocinnamic acid | 207981-48-4 | 2A-9001698 |
| 2,3-Difluoroethoxybenzene | 121219-07-6 | 2A-9001699 |
| 2,3-Difluorophenol | 6418-38-8 | 2A-9001700 |
| 2,3-Difluorophenylacetic acid | 145689-41-4 | 2A-9001701 |
| 2',3'-Difluoropropiophenone | 101712-19-0 | 2A-9001703 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA