
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40335-00-0 |
| Catalog No. | 2A-1169550 |
| Chinese Name | 2,4-二甲氧基喹啉 |
| Synonyms | 2,4-dimethoxyquinolone; quinoline,2,4-dimethoxy; 2,4-Dimethoxy-chinolin; 2,4-dimethoxy-quinoline |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21100 |
| Purity | 98 |
| Density | 1.148g/cm3 |
| Boiling Point | 272.9ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 147591 |
| SMILES | COc1cc(OC)c2ccccc2n1 |
| InChI | InChI=1S/C11H11NO2/c1-13-10-7-11(14-2)12-9-6-4-3-5-8(9)10/h3-7H,1-2H3 |
| InChI Key | XSZBLRGKCBUWRJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-dihydroxy-3-propyl-1',1',1'-trifluoroacetophenone | 65239-69-2 | 2A-1168801 |
| 1-(2,4-dichloro-5-Methoxy-phenyl)-piperazine hydrochloride | 740806-45-5 | 2A-1168869 |
| Fluxapyroxad | 907204-31-3 | 2A-1169069 |
| 5,6-dichloropyrimidine-2,4-diamine | 89033-89-6 | 2A-1169086 |
| 5-CHLORO-3,1-BENZOXAZIN-2,4-DIONE | 20829-96-3 | 2A-1169526 |
| 2,4-diMethoxyquinoline-3-carbaldehyde | 51179-18-1 | 2A-1169551 |
| 5-CHLORO-1-METHYL-1H-BENZO[D][1,3]OXAZINE-2,4-DIONE | 40707-01-5 | 2A-1169642 |
| 1-(5-bromo-2,4-dihydroxyphenyl)ethanone | 60965-25-5 | 2A-1169645 |
| sodium bis[2-(3-chlorophenyl)-2,4-dihydro-4-[[2-hydroxy-5-mesylphenyl]azo]-5-methyl-3H-pyrazol-3-onato(2-)]chromate(1-) | 51147-75-2 | 2A-1169807 |
| Chromate(2-), [2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)]-, disodium | 56819-40-0 | 2A-1169811 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA