
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 139726-35-5 |
| Catalog No. | 2A-1169405 |
| Chinese Name | 细叶远志苷 A |
| Synonyms | References |
| Molecular Formula | C31H38O17 |
| Molecular Weight | 682.623 |
| Purity | 98% |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 917.3±65.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | room temperature |
| Application | Tenuifoliside A is isolated from Polygala and has anti-apoptotic and antidepressant effects. In C6 cells, Tenuifoliside A exhibited its neurotrophic effects and promoted cell proliferation through the |
| PubChem ID | 85736616 |
| SMILES | COc1cc(C=CC(=O)OC2C(O)C(CO)OC2(CO)OC2OC(COC(=O)c3ccc(O)cc3)C(O)C(O)C2O)cc(OC)c1OC |
| InChI | InChI=1S/C31H38O17/c1-41-18-10-15(11-19(42-2)27(18)43-3)4-9-22(35)46-28-24(37)20(12-32)47-31(28,14-33)48-30-26(39)25(38)23(36)21(45-30)13-44-29(40)16-5-7-17(34)8-6-16/h4-11,20-21,23-26,28,30,32-34,36-39H,12-14H2,1-3H3/b9-4+/t20-,21-,23-,24-,25+,26-,28+,30-,31+/m1/s1 |
| InChI Key | BBUQNXDJRVCZTI-DFAXWHGISA-N |
| Transport Info | Product name: Polygala sucrose ester A |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PolyphyllinH | 81917-50-2 | 2A-1169397 |
| demethylwedelolactone | 6468-55-9 | 2A-1169398 |
| Lobetyolin | 136085-37-5 | 2A-1169401 |
| Tenuifoliose A | 139682-01-2 | 2A-1169402 |
| Tenuifoliose J | 147742-14-1 | 2A-1169404 |
| Tenuifoliside B | 139726-36-6 | 2A-1169406 |
| Tenuifoliside C | 139726-37-7 | 2A-1169407 |
| Arillanin A | 154287-47-5 | 2A-1169408 |
| demethylzeylasteral | 107316-88-1 | 2A-1169416 |
| Corynoxine | 6877-32-3 | 2A-1169417 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA