CAS Number100366-66-3
Synonyms6,6''-Dibrom-2,2':6',2''-terpyridin; 2,6''-dibromo-2,2':6,2''-bipyridine; 6,6'-dibromo-2,2':6',2''-terpyridine; MFCD01863557; 6,6''-Dibromo-2,2':6',2''-terpyridine; 2",6-dibromo-2,2':6',6"-terpyridine
Molecular FormulaC15H9Br2N3
Molecular Weight391.060
Density1.7±0.1 g/cm3
Boiling Point473.0±40.0 °C at 760 mmHg
Melting Point257-263ºC(lit.)
AppearanceWhite - light reddish yellow crystal - powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100366-66-3 |
| Catalog No. | 2A-1169298 |
| Chinese Name | 6,6''-二溴-2,2':6',2''-三联吡啶 |
| Synonyms | 6,6''-Dibrom-2,2':6',2''-terpyridin; 2,6''-dibromo-2,2':6,2''-bipyridine; 6,6'-dibromo-2,2':6',2''-terpyridine; MFCD01863557; 6,6''-Dibromo-2,2':6',2''-terpyridine; 2",6-dibromo-2,2':6',6"-terpyridine |
| Molecular Formula | C15H9Br2N3 |
| Molecular Weight | 391.060 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 473.0±40.0 °C at 760 mmHg |
| Melting Point | 257-263ºC(lit.) |
| Appearance | White - light reddish yellow crystal - powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933399090 |
| PubChem ID | 6198276 |
| SMILES | Brc1cccc(-c2cccc(-c3cccc(Br)n3)n2)n1 |
| InChI | InChI=1S/C15H9Br2N3/c16-14-8-2-6-12(19-14)10-4-1-5-11(18-10)13-7-3-9-15(17)20-13/h1-9H |
| InChI Key | PYMBATDYUCQLBC-UHFFFAOYSA-N |
| MSDS | msds/169393_2_100366_66_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,4',5,5'-Tetramethyl-2,2'-bipyridine | 1762-35-2 | 2A-1169286 |
| 4,4',6,6'-TETRAMETHYL-2,2'-BIPYRIDINE | 4444-27-3 | 2A-1169287 |
| 4,4',4''-TRI-TERT-BUTYL-2,2':6',2''-TERPYRIDINE | 115091-29-7 | 2A-1169288 |
| potassium 2-(4-chlorophenyl)-3-ethyl-5-oxo-pyridazine-4-carboxylate | 82697-71-0 | 2A-1169296 |
| 4'-METHYL-2,2':6',2''-TERPYRIDINE | 72036-41-0 | 2A-1169297 |
| 5-hydroxy-4-methyl-2-benzofuran-1(3H)-one | 1194700-73-6 | 2A-1169299 |
| 1-ACETYL-4-(2-HYDROXY-ETHYL)-PIPERAZINE X HCL | 83502-55-0 | 2A-1169301 |
| TETRA-O-BENZOYL-D-XYLOFURANOSE | 5432-87-1 | 2A-1169312 |
| 2-Tributylstannylbenzo[b]furan | 148961-81-3 | 2A-1169314 |
| 5-Ethyl-1H-indole-2,3-dione | 96202-56-1 | 2A-1169325 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS